Difference between revisions of "PWY-7274"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E-PHENYLITACONYL-COA E-PHENYLITACONYL-COA] == * common-name: ** (e)-2-benzylidenesuccinyl-coa *...")
(Created page with "Category:pathway == Pathway PWY-7274 == * taxonomic-range: ** tax-2062 * common-name: ** d-cycloserine biosynthesis == Reaction(s) found == * SERINE-O-ACETTRAN-RXN ==...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=E-PHENYLITACONYL-COA E-PHENYLITACONYL-COA] ==
+
== Pathway PWY-7274 ==
 +
* taxonomic-range:
 +
** tax-2062
 
* common-name:
 
* common-name:
** (e)-2-benzylidenesuccinyl-coa
+
** d-cycloserine biosynthesis
* smiles:
+
== Reaction(s) found ==
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c(cc(=o)[o-])=cc1(c=cc=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
* [[SERINE-O-ACETTRAN-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** cizckpngzpendv-umuuvtgisa-i
+
* [NoneRXN-14457 RXN-14457]
* molecular-weight:
+
* [NoneRXN-14459 RXN-14459]
** 950.677
+
* [NoneRXN-14460 RXN-14460]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-12537 RXN-12537]
* [[RXN-902]]
+
* [NoneRXN-14458 RXN-14458]
== Reaction(s) known to produce the compound ==
+
{{#set: taxonomic-range=tax-2062}}
== Reaction(s) of unknown directionality ==
+
{{#set: common-name=d-cycloserine biosynthesis}}
{{#set: common-name=(e)-2-benzylidenesuccinyl-coa}}
+
{{#set: nb reaction found=1}}
{{#set: inchi-key=inchikey=cizckpngzpendv-umuuvtgisa-i}}
+
{{#set: completion rate=0.17}}
{{#set: molecular-weight=950.677}}
+
{{#set: nb total reaction=6}}

Latest revision as of 10:57, 18 March 2021

Pathway PWY-7274

  • taxonomic-range:
    • tax-2062
  • common-name:
    • d-cycloserine biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-14457 RXN-14457]
  • [NoneRXN-14459 RXN-14459]
  • [NoneRXN-14460 RXN-14460]
  • [NoneRXN-12537 RXN-12537]
  • [NoneRXN-14458 RXN-14458]