Difference between revisions of "PWY-5523"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CINNAMOYL-COA CINNAMOYL-COA] == * common-name: ** (e)-cinnamoyl-coa * smiles: ** cc(c)(c(o)c(=o...")
(Created page with "Category:pathway == Pathway PWY-5523 == * taxonomic-range: ** tax-2 * common-name: ** 5,6-dimethylbenzimidazole biosynthesis i (aerobic) == Reaction(s) found == * RIBOFL...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CINNAMOYL-COA CINNAMOYL-COA] ==
+
== Pathway PWY-5523 ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** (e)-cinnamoyl-coa
+
** 5,6-dimethylbenzimidazole biosynthesis i (aerobic)
* smiles:
+
== Reaction(s) found ==
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)c=cc1(=cc=cc=c1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
+
* [[RIBOFLAVINKIN-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** jvnvhnhitfvwix-kzkudurgsa-j
+
* [NoneFMNREDUCT-RXN FMNREDUCT-RXN]
* molecular-weight:
+
* [NoneRXN-8771 RXN-8771]
** 893.648
+
{{#set: taxonomic-range=tax-2}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=5,6-dimethylbenzimidazole biosynthesis i (aerobic)}}
* [[RXN-7645]]
+
{{#set: nb reaction found=1}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.33}}
* [[RXN-2001]]
+
{{#set: nb total reaction=3}}
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=(e)-cinnamoyl-coa}}
 
{{#set: inchi-key=inchikey=jvnvhnhitfvwix-kzkudurgsa-j}}
 
{{#set: molecular-weight=893.648}}
 

Latest revision as of 10:58, 18 March 2021

Pathway PWY-5523

  • taxonomic-range:
    • tax-2
  • common-name:
    • 5,6-dimethylbenzimidazole biosynthesis i (aerobic)

Reaction(s) found

Reaction(s) not found

  • [NoneFMNREDUCT-RXN FMNREDUCT-RXN]
  • [NoneRXN-8771 RXN-8771]