Difference between revisions of "P641-PWY"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14159 CPD-14159] == * common-name: ** 6''-o-carbamoylkanamycin b * smiles: ** c([n+])c1(c(o...")
(Created page with "Category:pathway == Pathway P641-PWY == * taxonomic-range: ** tax-2 * common-name: ** phenylmercury acetate degradation == Reaction(s) found == * MERCURY-II-REDUCTASE-RX...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14159 CPD-14159] ==
+
== Pathway P641-PWY ==
 +
* taxonomic-range:
 +
** tax-2
 
* common-name:
 
* common-name:
** 6''-o-carbamoylkanamycin b
+
** phenylmercury acetate degradation
* smiles:
+
== Reaction(s) found ==
** c([n+])c1(c(o)c(o)c([n+])c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
+
* [[MERCURY-II-REDUCTASE-RXN]]
* inchi-key:
+
== Reaction(s) not found ==
** xcstznjiqfivpe-fqsmhnglsa-s
+
* [NoneR581-RXN R581-RXN]
* molecular-weight:
+
{{#set: taxonomic-range=tax-2}}
** 531.582
+
{{#set: common-name=phenylmercury acetate degradation}}
== Reaction(s) known to consume the compound ==
+
{{#set: nb reaction found=1}}
== Reaction(s) known to produce the compound ==
+
{{#set: completion rate=0.5}}
* [[RXN-14553]]
+
{{#set: nb total reaction=2}}
* [[RXN-15287]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=6''-o-carbamoylkanamycin b}}
 
{{#set: inchi-key=inchikey=xcstznjiqfivpe-fqsmhnglsa-s}}
 
{{#set: molecular-weight=531.582}}
 

Latest revision as of 10:58, 18 March 2021

Pathway P641-PWY

  • taxonomic-range:
    • tax-2
  • common-name:
    • phenylmercury acetate degradation

Reaction(s) found

Reaction(s) not found

  • [NoneR581-RXN R581-RXN]