Difference between revisions of "PWY-4321"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URATE URATE] == * common-name: ** urate * smiles: ** c12(nc(=o)nc=1c(=o)nc(=o)n2) * inchi-key:...") |
(Created page with "Category:pathway == Pathway PWY-4321 == * taxonomic-range: ** tax-33090 * common-name: ** l-glutamate degradation iv == Reaction(s) found == * GABATRANSAM-RXN * GLUT...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:pathway]] |
− | == | + | == Pathway PWY-4321 == |
+ | * taxonomic-range: | ||
+ | ** tax-33090 | ||
* common-name: | * common-name: | ||
− | ** | + | ** l-glutamate degradation iv |
− | + | == Reaction(s) found == | |
− | + | * [[GABATRANSAM-RXN]] | |
− | + | * [[GLUTDECARBOX-RXN]] | |
− | + | * [[SUCCINATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]] | |
− | + | == Reaction(s) not found == | |
− | + | * [NoneRXN-6902 RXN-6902] | |
− | == Reaction(s) | + | * [NoneRXN-11002 RXN-11002] |
− | * [[ | + | {{#set: taxonomic-range=tax-33090}} |
− | * [[ | + | {{#set: common-name=l-glutamate degradation iv}} |
− | == Reaction(s) | + | {{#set: nb reaction found=3}} |
− | * [ | + | {{#set: completion rate=0.6}} |
− | * [ | + | {{#set: nb total reaction=5}} |
− | |||
− | = | ||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: |
Latest revision as of 10:58, 18 March 2021
Pathway PWY-4321
- taxonomic-range:
- tax-33090
- common-name:
- l-glutamate degradation iv
Reaction(s) found
Reaction(s) not found
- [NoneRXN-6902 RXN-6902]
- [NoneRXN-11002 RXN-11002]