Difference between revisions of "PWY-5473"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NARINGENIN-CMPD NARINGENIN-CMPD] ==
+== Pathway PWY-5473 ==
+* taxonomic-range:
+** tax-3398
 * common-name:
-** (2s)-naringenin
+** hydroxycinnamic acid serotonin amides biosynthesis
-* smiles:
+== Reaction(s) found ==
-** c3(=c(c2(oc1(c(=c(c=c(c=1)o)o)c(c2)=o)))c=cc(=c3)o)
+* [[AROMATIC-L-AMINO-ACID-DECARBOXYLASE-RXN]]
-* inchi-key:
+== Reaction(s) not found ==
-** ftvwirxfelqlpi-zdusscgksa-n
+* [NoneRXN-8707 RXN-8707]
-* molecular-weight:
+* [NoneRXN-8712 RXN-8712]
-** 272.257
+* [NoneRXN-8710 RXN-8710]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN-8711 RXN-8711]
-* [[NARINGENIN-3-DIOXYGENASE-RXN]]
+* [NoneRXN-8709 RXN-8709]
-== Reaction(s) known to produce the compound ==
+{{#set: taxonomic-range=tax-3398}}
-* [[APIGNAR-RXN]]
+{{#set: common-name=hydroxycinnamic acid serotonin amides biosynthesis}}
-== Reaction(s) of unknown directionality ==
+{{#set: nb reaction found=1}}
-{{#set: common-name=(2s)-naringenin}}
+{{#set: completion rate=0.17}}
-{{#set: inchi-key=inchikey=ftvwirxfelqlpi-zdusscgksa-n}}
+{{#set: nb total reaction=6}}
-{{#set: molecular-weight=272.257}}