Difference between revisions of "PWY-6644"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE 2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE] == * common-name: **...")
(Created page with "Category:pathway == Pathway PWY-6644 == * taxonomic-range: ** tax-33090 ** tax-2 * common-name: ** fluoroacetate and fluorothreonine biosynthesis == Reaction(s) found == *...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE 2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE] ==
+
== Pathway PWY-6644 ==
 +
* taxonomic-range:
 +
** tax-33090
 +
** tax-2
 
* common-name:
 
* common-name:
** 2-carboxy-d-arabinitol 1-phosphate
+
** fluoroacetate and fluorothreonine biosynthesis
* smiles:
+
== Reaction(s) found ==
** c(c(c(c(cop([o-])([o-])=o)(c([o-])=o)o)o)o)o
+
* [[RXN-11743]]
* inchi-key:
+
== Reaction(s) not found ==
** ujtmirnfexkgms-uhfffaoysa-k
+
* [NoneRXN-11746 RXN-11746]
* molecular-weight:
+
* [None2.5.1.63-RXN 2.5.1.63-RXN]
** 273.113
+
* [NoneRXN-11745 RXN-11745]
== Reaction(s) known to consume the compound ==
+
* [NoneRXN-11747 RXN-11747]
* [[2-CARBOXY-D-ARABINITOL-1-PHOSPHATASE-RXN]]
+
* [NoneRXN-11744 RXN-11744]
== Reaction(s) known to produce the compound ==
+
{{#set: taxonomic-range=tax-2|tax-33090}}
== Reaction(s) of unknown directionality ==
+
{{#set: common-name=fluoroacetate and fluorothreonine biosynthesis}}
{{#set: common-name=2-carboxy-d-arabinitol 1-phosphate}}
+
{{#set: nb reaction found=1}}
{{#set: inchi-key=inchikey=ujtmirnfexkgms-uhfffaoysa-k}}
+
{{#set: completion rate=0.17}}
{{#set: molecular-weight=273.113}}
+
{{#set: nb total reaction=6}}

Latest revision as of 10:58, 18 March 2021

Pathway PWY-6644

  • taxonomic-range:
    • tax-33090
    • tax-2
  • common-name:
    • fluoroacetate and fluorothreonine biosynthesis

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-11746 RXN-11746]
  • [None2.5.1.63-RXN 2.5.1.63-RXN]
  • [NoneRXN-11745 RXN-11745]
  • [NoneRXN-11747 RXN-11747]
  • [NoneRXN-11744 RXN-11744]