Difference between revisions of "PWY-6035"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4205 CPD-4205] ==
+== Pathway PWY-6035 ==
+* taxonomic-range:
+** tax-33090
 * common-name:
-** n6-(&delta;2-isopentenyl)-adenosine 5'-monophosphate
+** 2,3-cis-flavanols biosynthesis
-* smiles:
+== Reaction(s) found ==
-** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop([o-])([o-])=o)o)o))c=nc=23)))c
+* [[RXN-9725]]
-* inchi-key:
+== Reaction(s) not found ==
-** duiszflwbaprbr-sdbhatresa-l
+* [NoneRXN-9723 RXN-9723]
-* molecular-weight:
+* [NoneRXN-9724 RXN-9724]
-** 413.326
+{{#set: taxonomic-range=tax-33090}}
-== Reaction(s) known to consume the compound ==
+{{#set: common-name=2,3-cis-flavanols biosynthesis}}
-* [[RXN-4311]]
+{{#set: nb reaction found=1}}
-* [[RXN-4313]]
+{{#set: completion rate=0.33}}
-* [[RXN-4313-CPD-4205/WATER//CPD-15318/CPD-4209.35.]]
+{{#set: nb total reaction=3}}
-* [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]]
-== Reaction(s) known to produce the compound ==
-* [[RXN-4307]]
-* [[RXN-4311]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=n6-(&delta;2-isopentenyl)-adenosine 5'-monophosphate}}
-{{#set: inchi-key=inchikey=duiszflwbaprbr-sdbhatresa-l}}
-{{#set: molecular-weight=413.326}}