Difference between revisions of "PWY-6938"

Latest revision as of 10:59, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13118 CPD-13118] ==
+== Pathway PWY-6938 ==
+* taxonomic-range:
+** tax-2759
+** tax-2
+** tax-2157
 * common-name:
-** gdp-&beta;-l-fucose
+** nadh repair
-* smiles:
+== Reaction(s) found ==
-** cc4(oc(op(op(occ3(c(c(c(n2(c1(=c(c(nc(=n1)n)=o)n=c2)))o3)o)o))([o-])=o)([o-])=o)c(c(c4o)o)o)
+* [[4.2.1.93-RXN]]
-* inchi-key:
+* [[RXN-12752]]
-** lqebexmhblqmdb-jgqubwhwsa-l
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN-12753 RXN-12753]
-** 587.33
+* [NoneRXN-12754 RXN-12754]
-== Reaction(s) known to consume the compound ==
+{{#set: taxonomic-range=tax-2|tax-2157|tax-2759}}
-* [[2.4.1.221-RXN]]
+{{#set: common-name=nadh repair}}
-* [[2.4.1.68-RXN]]
+{{#set: nb reaction found=2}}
-* [[GALACTOSIDE-2-L-FUCOSYLTRANSFERASE-RXN]]
+{{#set: completion rate=0.5}}
-* [[GALACTOSIDE-3-FUCOSYLTRANSFERASE-RXN]]
+{{#set: nb total reaction=4}}
-* [[RXN-9463]]
-== Reaction(s) known to produce the compound ==
-* [[1.1.1.271-RXN]]
-* [[2.4.1.221-RXN]]
-== Reaction(s) of unknown directionality ==
-{{#set: common-name=gdp-&beta;-l-fucose}}
-{{#set: inchi-key=inchikey=lqebexmhblqmdb-jgqubwhwsa-l}}
-{{#set: molecular-weight=587.33}}