Difference between revisions of "PWY-6054"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8168 CPD-8168] == * common-name: ** 1-18:3-2-18:3-monogalactosyldiacylglycerol * smiles: **...")
(Created page with "Category:pathway == Pathway PWY-6054 == * taxonomic-range: ** tax-33090 * common-name: ** dimethylsulfoniopropanoate biosynthesis i (wollastonia) == Reaction(s) found == *...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8168 CPD-8168] ==
+
== Pathway PWY-6054 ==
 +
* taxonomic-range:
 +
** tax-33090
 
* common-name:
 
* common-name:
** 1-18:3-2-18:3-monogalactosyldiacylglycerol
+
** dimethylsulfoniopropanoate biosynthesis i (wollastonia)
* smiles:
+
== Reaction(s) found ==
** ccc=ccc=ccc=ccccccccc(occ(coc1(oc(co)c(o)c(o)c(o)1))oc(=o)cccccccc=ccc=ccc=ccc)=o
+
* [[RXN-9758]]
* inchi-key:
+
== Reaction(s) not found ==
** quzhzfaqjatmca-qazqwddosa-n
+
* [NoneRXN-9759 RXN-9759]
* molecular-weight:
+
* [NoneMETHIONINE-S-METHYLTRANSFERASE-RXN METHIONINE-S-METHYLTRANSFERASE-RXN]
** 775.074
+
{{#set: taxonomic-range=tax-33090}}
== Reaction(s) known to consume the compound ==
+
{{#set: common-name=dimethylsulfoniopropanoate biosynthesis i (wollastonia)}}
== Reaction(s) known to produce the compound ==
+
{{#set: nb reaction found=1}}
* [[RXN-8368]]
+
{{#set: completion rate=0.33}}
== Reaction(s) of unknown directionality ==
+
{{#set: nb total reaction=3}}
{{#set: common-name=1-18:3-2-18:3-monogalactosyldiacylglycerol}}
 
{{#set: inchi-key=inchikey=quzhzfaqjatmca-qazqwddosa-n}}
 
{{#set: molecular-weight=775.074}}
 

Latest revision as of 10:59, 18 March 2021

Pathway PWY-6054

  • taxonomic-range:
    • tax-33090
  • common-name:
    • dimethylsulfoniopropanoate biosynthesis i (wollastonia)

Reaction(s) found

Reaction(s) not found

  • [NoneRXN-9759 RXN-9759]
  • [NoneMETHIONINE-S-METHYLTRANSFERASE-RXN METHIONINE-S-METHYLTRANSFERASE-RXN]