Difference between revisions of "SJ02706"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROFOLATE DIHYDROFOLATE] == * common-name: ** 7,8-dihydrofolate monoglutamate * smiles: **...")
(Created page with "Category:gene == Gene SJ02706 == * transcription-direction: ** negative * right-end-position: ** 26336 * left-end-position: ** 8295 * centisome-position: ** 1.5524377...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROFOLATE DIHYDROFOLATE] ==
+
== Gene SJ02706 ==
−
* common-name:
+
* transcription-direction:
−
** 7,8-dihydrofolate monoglutamate
+
** negative
−
* smiles:
+
* right-end-position:
−
** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3))
+
** 26336
−
* inchi-key:
+
* left-end-position:
−
** ozrnssudzolusn-lbprgkrzsa-l
+
** 8295
−
* molecular-weight:
+
* centisome-position:
−
** 441.402
+
** 1.5524377   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
* [[DHFR2i]]
+
* [[S.japonica_carotenoid_curated]]
−
* [[DHFRi]]
+
== Reaction(s) associated ==
−
* [[MDUMT]]
+
* [[5.3.4.1-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
−
* [[DHFOR]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
* [[DIHYDROFOLATESYNTH-RXN]]
+
* [[DISULISOM-RXN]]
−
* [[FOLR2]]
+
** Category: [[annotation]]
−
* [[MDUMT]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
== Reaction(s) of unknown directionality ==
+
{{#set: transcription-direction=negative}}
−
{{#set: common-name=7,8-dihydrofolate monoglutamate}}
+
{{#set: right-end-position=26336}}
−
{{#set: inchi-key=inchikey=ozrnssudzolusn-lbprgkrzsa-l}}
+
{{#set: left-end-position=8295}}
−
{{#set: molecular-weight=441.402}}
+
{{#set: centisome-position=1.5524377    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:01, 18 March 2021

Gene SJ02706

  • transcription-direction:
    • negative
  • right-end-position:
    • 26336
  • left-end-position:
    • 8295
  • centisome-position:
    • 1.5524377

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ02706&oldid=131769"