Difference between revisions of "SJ11751"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_PYRUVATE INDOLE_PYRUVATE] == * common-name: ** (indol-3-yl)pyruvate * smiles: ** c([o-])...")
(Created page with "Category:gene == Gene SJ11751 == * transcription-direction: ** negative * right-end-position: ** 207893 * left-end-position: ** 199791 * centisome-position: ** 54.41346...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_PYRUVATE INDOLE_PYRUVATE] ==
+
== Gene SJ11751 ==
* common-name:
+
* transcription-direction:
** (indol-3-yl)pyruvate
+
** negative
* smiles:
+
* right-end-position:
** c([o-])(=o)c(=o)cc1(=cnc2(c=cc=cc1=2))
+
** 207893
* inchi-key:
+
* left-end-position:
** rstklpzezygqpy-uhfffaoysa-m
+
** 199791
* molecular-weight:
+
* centisome-position:
** 202.189
+
** 54.41346   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXNDQC-2]]
+
* [[S.japonica_carotenoid_curated]]
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
+
== Reaction(s) associated ==
== Reaction(s) known to produce the compound ==
+
* [[RXN-8344]]
* [[TRYPTOPHAN-AMINOTRANSFERASE-RXN]]
+
** Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: common-name=(indol-3-yl)pyruvate}}
+
* [[RXN-8348]]
{{#set: inchi-key=inchikey=rstklpzezygqpy-uhfffaoysa-m}}
+
** Category: [[annotation]]
{{#set: molecular-weight=202.189}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
== Pathway(s) associated ==
 +
* [[PWY-6823]]
 +
** '''7''' reactions found over '''6''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=207893}}
 +
{{#set: left-end-position=199791}}
 +
{{#set: centisome-position=54.41346    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:02, 18 March 2021

Gene SJ11751

  • transcription-direction:
    • negative
  • right-end-position:
    • 207893
  • left-end-position:
    • 199791
  • centisome-position:
    • 54.41346

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-6823
    • 7 reactions found over 6 reactions in the full pathway