Difference between revisions of "SJ11151"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] == * common-name: ** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate * s...")
(Created page with "Category:gene == Gene SJ11151 == * transcription-direction: ** negative * right-end-position: ** 303991 * left-end-position: ** 298300 * centisome-position: ** 78.86318...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] ==
+
== Gene SJ11151 ==
* common-name:
+
* transcription-direction:
** n6-(δ2-isopentenyl)-adenosine 5'-triphosphate
+
** negative
* smiles:
+
* right-end-position:
** cc(=ccnc3(=nc=nc2(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)([o-])=o)o)o))c=nc=23)))c
+
** 303991
* inchi-key:
+
* left-end-position:
** oplvztyvquwkhb-sdbhatresa-k
+
** 298300
* molecular-weight:
+
* centisome-position:
** 572.278
+
** 78.86318   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-4303]]
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[3.4.22.68-RXN]]
{{#set: common-name=n6-(δ2-isopentenyl)-adenosine 5'-triphosphate}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=oplvztyvquwkhb-sdbhatresa-k}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=572.278}}
+
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=303991}}
 +
{{#set: left-end-position=298300}}
 +
{{#set: centisome-position=78.86318    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:02, 18 March 2021

Gene SJ11151

  • transcription-direction:
    • negative
  • right-end-position:
    • 303991
  • left-end-position:
    • 298300
  • centisome-position:
    • 78.86318

Organism(s) associated with this gene

Reaction(s) associated