Difference between revisions of "SJ16019"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8090 CPD-8090] == * common-name: ** 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine *...")
 
(Created page with "Category:gene == Gene SJ16019 == * transcription-direction: ** positive * right-end-position: ** 310135 * left-end-position: ** 294174 * centisome-position: ** 42.540386...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8090 CPD-8090] ==
+
== Gene SJ16019 ==
* common-name:
+
* transcription-direction:
** 1-α-linolenoyl-2-linoleoyl-phosphatidylcholine
+
** positive
* smiles:
+
* right-end-position:
** ccc=ccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
+
** 310135
* inchi-key:
+
* left-end-position:
** qfdyidgukxrpkh-vslglsmxsa-n
+
** 294174
* molecular-weight:
+
* centisome-position:
** 780.076
+
** 42.540386   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-8331]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN-8323]]
+
* [[HOMOSERDEHYDROG-RXN]]
* [[RXN-8330]]
+
** Category: [[annotation]]
== Reaction(s) of unknown directionality ==
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: common-name=1-α-linolenoyl-2-linoleoyl-phosphatidylcholine}}
+
** Category: [[orthology]]
{{#set: inchi-key=inchikey=qfdyidgukxrpkh-vslglsmxsa-n}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: molecular-weight=780.076}}
+
== Pathway(s) associated ==
 +
* [[HOMOSERSYN-PWY]]
 +
** '''3''' reactions found over '''3''' reactions in the full pathway
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=310135}}
 +
{{#set: left-end-position=294174}}
 +
{{#set: centisome-position=42.540386    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ16019

  • transcription-direction:
    • positive
  • right-end-position:
    • 310135
  • left-end-position:
    • 294174
  • centisome-position:
    • 42.540386

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated