Difference between revisions of "SJ06042"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] == * common-name: ** β-l-galactose 1-phosphate * smiles: ** c(o)c1(c(o)c(...")
(Created page with "Category:gene == Gene SJ06042 == * transcription-direction: ** negative * right-end-position: ** 224267 * left-end-position: ** 206792 * centisome-position: ** 42.841045...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-4 CPDQT-4] ==
+
== Gene SJ06042 ==
* common-name:
+
* transcription-direction:
** β-l-galactose 1-phosphate
+
** negative
* smiles:
+
* right-end-position:
** c(o)c1(c(o)c(o)c(o)c(op([o-])([o-])=o)o1)
+
** 224267
* inchi-key:
+
* left-end-position:
** hxxfsfrbohsimq-sxuwkvjysa-l
+
** 206792
* molecular-weight:
+
* centisome-position:
** 258.121
+
** 42.841045   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXNQT-4142]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
* [[RXN4FS-12]]
+
* [[2.7.13.3-RXN]]
* [[RXN4FS-13]]
+
** Category: [[annotation]]
* [[RXNQT-4141]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
== Reaction(s) of unknown directionality ==
+
* [[PROTEIN-KINASE-RXN]]
{{#set: common-name=β-l-galactose 1-phosphate}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-sxuwkvjysa-l}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=258.121}}
+
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=224267}}
 +
{{#set: left-end-position=206792}}
 +
{{#set: centisome-position=42.841045    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}

Latest revision as of 11:03, 18 March 2021

Gene SJ06042

  • transcription-direction:
    • negative
  • right-end-position:
    • 224267
  • left-end-position:
    • 206792
  • centisome-position:
    • 42.841045

Organism(s) associated with this gene

Reaction(s) associated