Difference between revisions of "SJ00093"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMOGENTISATE HOMOGENTISATE] == * common-name: ** homogentisate * smiles: ** c1(c(=cc(=c(c=1)o)...")
 
(Created page with "Category:gene == Gene SJ00093 == * transcription-direction: ** negative * right-end-position: ** 725383 * left-end-position: ** 719570 * centisome-position: ** 64.2875...")
 
(9 intermediate revisions by 4 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMOGENTISATE HOMOGENTISATE] ==
+
== Gene SJ00093 ==
* common-name:
+
* transcription-direction:
** homogentisate
+
** negative
* smiles:
+
* right-end-position:
** c1(c(=cc(=c(c=1)o)cc([o-])=o)o)
+
** 725383
* inchi-key:
+
* left-end-position:
** igmnyecmumzddf-uhfffaoysa-m
+
** 719570
* molecular-weight:
+
* centisome-position:
** 167.141
+
** 64.2875   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[RXN-14929]]
+
* [[S.japonica_carotenoid_curated]]
* [[RXN-2541]]
+
== Reaction(s) associated ==
* [[RXN-2761]]
+
* [[PROTEIN-KINASE-RXN]]
== Reaction(s) known to produce the compound ==
+
** Category: [[annotation]]
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
* [[HPPD]]
+
* [[RXN-8443]]
== Reaction(s) of unknown directionality ==
+
** Category: [[orthology]]
{{#set: common-name=homogentisate}}
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
{{#set: inchi-key=inchikey=igmnyecmumzddf-uhfffaoysa-m}}
+
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
{{#set: molecular-weight=167.141}}
+
== Pathway(s) associated ==
 +
* [[PWY-5381]]
 +
** '''6''' reactions found over '''11''' reactions in the full pathway
 +
{{#set: transcription-direction=negative}}
 +
{{#set: right-end-position=725383}}
 +
{{#set: left-end-position=719570}}
 +
{{#set: centisome-position=64.2875    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=2}}
 +
{{#set: nb pathway associated=1}}

Latest revision as of 11:03, 18 March 2021

Gene SJ00093

  • transcription-direction:
    • negative
  • right-end-position:
    • 725383
  • left-end-position:
    • 719570
  • centisome-position:
    • 64.2875

Organism(s) associated with this gene

Reaction(s) associated

Pathway(s) associated

  • PWY-5381
    • 6 reactions found over 11 reactions in the full pathway