Difference between revisions of "SJ05426"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] == * common-name: ** dctp * smiles: ** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(...")
(Created page with "Category:gene == Gene SJ05426 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * NO3t ** Category: or...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCTP DCTP] ==
+
== Gene SJ05426 ==
* common-name:
+
== Organism(s) associated with this gene  ==
** dctp
+
* [[S.japonica_carotenoid_curated]]
* smiles:
+
== Reaction(s) associated ==
** c(c2(c(cc(n1(c(n=c(c=c1)n)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
+
* [[NO3t]]
* inchi-key:
+
** Category: [[orthology]]
** rgwhqcvhvjxokc-shyzeuofsa-j
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
* molecular-weight:
+
* [[TCV3]]
** 463.127
+
** Category: [[orthology]]
== Reaction(s) known to consume the compound ==
+
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
* [[DCTCP]]
+
* [[TRANS-RXN-137]]
* [[DCTP-PYROPHOSPHATASE-RXN]]
+
** Category: [[orthology]]
* [[DCTPtm]]
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
* [[DCTUP]]
+
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
* [[RXN-14198]]
+
{{#set: organism associated=S.japonica_carotenoid_curated}}
* [[RXN-14216]]
+
{{#set: nb reaction associated=3}}
== Reaction(s) known to produce the compound ==
 
* [[ATDCD]]
 
* [[ATDCDm]]
 
* [[DCDPKIN-RXN]]
 
* [[DCTPtm]]
 
* [[RXN0-723]]
 
== Reaction(s) of unknown directionality ==
 
{{#set: common-name=dctp}}
 
{{#set: inchi-key=inchikey=rgwhqcvhvjxokc-shyzeuofsa-j}}
 
{{#set: molecular-weight=463.127}}
 

Latest revision as of 11:04, 18 March 2021

Gene SJ05426

Organism(s) associated with this gene

Reaction(s) associated