Difference between revisions of "SJ11651"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] == * common-name: ** adp ribose 1'',2''-cyclic phosphate * smiles: ** c(c3(c...")
 
(Created page with "Category:gene == Gene SJ11651 == * transcription-direction: ** positive * right-end-position: ** 71477 * left-end-position: ** 69090 * centisome-position: ** 8.864796...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:metabolite]]
+
[[Category:gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] ==
+
== Gene SJ11651 ==
−
* common-name:
+
* transcription-direction:
−
** adp ribose 1'',2''-cyclic phosphate
+
** positive
−
* smiles:
+
* right-end-position:
−
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])occ5(c(o)c4(c(op([o-])(=o)o4)o5)))([o-])=o
+
** 71477
−
* inchi-key:
+
* left-end-position:
−
** npspryxpogpcpm-tyasjmozsa-k
+
** 69090
−
* molecular-weight:
+
* centisome-position:
−
** 618.26
+
** 8.864796   
−
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
−
== Reaction(s) known to produce the compound ==
+
* [[S.japonica_carotenoid_curated]]
−
* [[2.7.1.160-RXN]]
+
== Reaction(s) associated ==
−
== Reaction(s) of unknown directionality ==
+
* [[3.1.26.4-RXN]]
−
{{#set: common-name=adp ribose 1'',2''-cyclic phosphate}}
+
** Category: [[annotation]]
−
{{#set: inchi-key=inchikey=npspryxpogpcpm-tyasjmozsa-k}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
−
{{#set: molecular-weight=618.26}}
+
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
* [[RNA-DIRECTED-DNA-POLYMERASE-RXN]]
 +
** Category: [[annotation]]
 +
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=71477}}
 +
{{#set: left-end-position=69090}}
 +
{{#set: centisome-position=8.864796    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=3}}

Latest revision as of 11:03, 18 March 2021

Gene SJ11651

  • transcription-direction:
    • positive
  • right-end-position:
    • 71477
  • left-end-position:
    • 69090
  • centisome-position:
    • 8.864796

Organism(s) associated with this gene

Reaction(s) associated




Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=SJ11651&oldid=133122"