Difference between revisions of "SJ20743"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] == * common-name: ** l-lysine * smiles: ** c([n+])cccc([n+])c([o-])=o * inchi-key: **...") |
(Created page with "Category:gene == Gene SJ20743 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RXN-9463 ** Category:...") |
||
(9 intermediate revisions by 5 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:gene]] |
− | == | + | == Gene SJ20743 == |
− | * | + | == Organism(s) associated with this gene == |
− | + | * [[S.japonica_carotenoid_curated]] | |
− | + | == Reaction(s) associated == | |
− | + | * [[RXN-9463]] | |
− | + | ** Category: [[orthology]] | |
− | + | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
− | + | == Pathway(s) associated == | |
− | + | * [[PWY-5936]] | |
− | == Reaction(s) | + | ** '''1''' reactions found over '''6''' reactions in the full pathway |
− | * [[ | + | {{#set: organism associated=S.japonica_carotenoid_curated}} |
− | * [[ | + | {{#set: nb reaction associated=1}} |
− | * [[ | + | {{#set: nb pathway associated=1}} |
− | |||
− | == | ||
− | * [[ | ||
− | * | ||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: |
Latest revision as of 11:04, 18 March 2021
Contents
Gene SJ20743
Organism(s) associated with this gene
Reaction(s) associated
- RXN-9463
- Category: orthology
- source: output_pantograph_ectocarpus_siliculosus; tool: pantograph; comment: n.a
- Category: orthology
Pathway(s) associated
- PWY-5936
- 1 reactions found over 6 reactions in the full pathway