Difference between revisions of "PWY-5035"

Latest revision as of 10:58, 18 March 2021

@@ Line 1: / Line 1: @@
-[[Category:metabolite]]
+[[Category:pathway]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19163 CPD-19163] ==
+== Pathway PWY-5035 ==
+* taxonomic-range:
+** tax-58023
+** tax-3195
 * common-name:
-** (2e,11z)-octadecenoyl-coa
+** gibberellin biosynthesis iii (early c-13 hydroxylation)
-* smiles:
+== Reaction(s) found ==
-** ccccccc=ccccccccc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+* [[RXN1F-167]]
-* inchi-key:
+* [[RXN1F-168]]
-** opmpwwfmnywbgf-pkybcsrxsa-j
+== Reaction(s) not found ==
-* molecular-weight:
+* [NoneRXN1F-169 RXN1F-169]
-** 1025.937
+* [NoneRXN-6524 RXN-6524]
-== Reaction(s) known to consume the compound ==
+* [NoneRXN1F-101 RXN1F-101]
-* [[RXN-17785]]
+* [NoneRXN1F-170 RXN1F-170]
-== Reaction(s) known to produce the compound ==
+* [NoneRXN1F-143 RXN1F-143]
-* [[RXN-17784]]
+{{#set: taxonomic-range=tax-3195|tax-58023}}
-== Reaction(s) of unknown directionality ==
+{{#set: common-name=gibberellin biosynthesis iii (early c-13 hydroxylation)}}
-{{#set: common-name=(2e,11z)-octadecenoyl-coa}}
+{{#set: nb reaction found=2}}
-{{#set: inchi-key=inchikey=opmpwwfmnywbgf-pkybcsrxsa-j}}
+{{#set: completion rate=0.29}}
-{{#set: molecular-weight=1025.937}}
+{{#set: nb total reaction=7}}