Difference between revisions of "SJ11654"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7158 CPD-7158] == * common-name: ** 3-demethylubiquinol-9 * smiles: ** cc(c)=cccc(c)=cccc(c...")
 
(Created page with "Category:gene == Gene SJ11654 == * transcription-direction: ** positive * right-end-position: ** 633557 * left-end-position: ** 631865 * centisome-position: ** 81.073296...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:metabolite]]
+
[[Category:gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7158 CPD-7158] ==
+
== Gene SJ11654 ==
* common-name:
+
* transcription-direction:
** 3-demethylubiquinol-9
+
** positive
* smiles:
+
* right-end-position:
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(=c(c)c(o)=c(o)c(oc)=c(o)1)
+
** 633557
* inchi-key:
+
* left-end-position:
** alajatogwwbpqt-nscwjznlsa-n
+
** 631865
* molecular-weight:
+
* centisome-position:
** 783.228
+
** 81.073296   
== Reaction(s) known to consume the compound ==
+
== Organism(s) associated with this gene  ==
* [[2.1.1.64-RXN]]
+
* [[S.japonica_carotenoid_curated]]
== Reaction(s) known to produce the compound ==
+
== Reaction(s) associated ==
== Reaction(s) of unknown directionality ==
+
* [[PROTEIN-KINASE-RXN]]
{{#set: common-name=3-demethylubiquinol-9}}
+
** Category: [[annotation]]
{{#set: inchi-key=inchikey=alajatogwwbpqt-nscwjznlsa-n}}
+
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
{{#set: molecular-weight=783.228}}
+
** Category: [[orthology]]
 +
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 +
{{#set: transcription-direction=positive}}
 +
{{#set: right-end-position=633557}}
 +
{{#set: left-end-position=631865}}
 +
{{#set: centisome-position=81.073296    }}
 +
{{#set: organism associated=S.japonica_carotenoid_curated}}
 +
{{#set: nb reaction associated=1}}

Latest revision as of 11:04, 18 March 2021

Gene SJ11654

  • transcription-direction:
    • positive
  • right-end-position:
    • 633557
  • left-end-position:
    • 631865
  • centisome-position:
    • 81.073296

Organism(s) associated with this gene

Reaction(s) associated