Difference between revisions of "CPD-2182"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ03397 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * UNSPECIFIC-MONOOXYGENASE...") |
(Created page with "Category:metabolite == Metabolite CPD-2182 == * common-name: ** 1-linoleoyl-2-linoleoyl-phosphatidylcholine * smiles: ** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-2182 == |
− | == | + | * common-name: |
− | * | + | ** 1-linoleoyl-2-linoleoyl-phosphatidylcholine |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o |
− | * | + | * inchi-key: |
− | * | + | ** fvxdqwzbhixiej-lndkuqbdsa-n |
− | {{#set: | + | * molecular-weight: |
− | {{#set: | + | ** 782.092 |
+ | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-8323]] | ||
+ | * [[RXN-8329]] | ||
+ | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-8322]] | ||
+ | * [[RXN-8328]] | ||
+ | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=1-linoleoyl-2-linoleoyl-phosphatidylcholine}} | ||
+ | {{#set: inchi-key=inchikey=fvxdqwzbhixiej-lndkuqbdsa-n}} | ||
+ | {{#set: molecular-weight=782.092}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-2182
- common-name:
- 1-linoleoyl-2-linoleoyl-phosphatidylcholine
- smiles:
- cccccc=ccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
- inchi-key:
- fvxdqwzbhixiej-lndkuqbdsa-n
- molecular-weight:
- 782.092