Difference between revisions of "CPD-17383"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ18089 == * transcription-direction: ** negative * right-end-position: ** 250841 * left-end-position: ** 218681 * centisome-position: ** 62.05899...")
(Created page with "Category:metabolite == Metabolite CPD-17383 == * common-name: ** (2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa * smiles: ** ccc=ccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ18089 ==
+
== Metabolite CPD-17383 ==
* transcription-direction:
+
* common-name:
** negative
+
** (2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
* right-end-position:
+
* smiles:
** 250841
+
** ccc=ccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
* left-end-position:
+
* inchi-key:
** 218681
+
** mmzjvinjfsrjok-cynjbpnesa-j
* centisome-position:
+
* molecular-weight:
** 62.05899   
+
** 1102.034
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-16130]]
* [[RXN-14554]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=(2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=mmzjvinjfsrjok-cynjbpnesa-j}}
{{#set: transcription-direction=negative}}
+
{{#set: molecular-weight=1102.034}}
{{#set: right-end-position=250841}}
 
{{#set: left-end-position=218681}}
 
{{#set: centisome-position=62.05899    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-17383

  • common-name:
    • (2z,9z,12z,15z,18z,21z)-tetracosahexaenoyl-coa
  • smiles:
    • ccc=ccc=ccc=ccc=ccc=ccccccc=cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
  • inchi-key:
    • mmzjvinjfsrjok-cynjbpnesa-j
  • molecular-weight:
    • 1102.034

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality