Difference between revisions of "OXALACETIC ACID"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ19097 == * transcription-direction: ** negative * right-end-position: ** 324679 * left-end-position: ** 288785 * centisome-position: ** 25.313875...")
(Created page with "Category:metabolite == Metabolite OXALACETIC_ACID == * common-name: ** oxaloacetate * smiles: ** c(c([o-])=o)c(=o)c([o-])=o * inchi-key: ** khpxuqmniqbqev-uhfffaoysa-l * m...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ19097 ==
+
== Metabolite OXALACETIC_ACID ==
* transcription-direction:
+
* common-name:
** negative
+
** oxaloacetate
* right-end-position:
+
* smiles:
** 324679
+
** c(c([o-])=o)c(=o)c([o-])=o
* left-end-position:
+
* inchi-key:
** 288785
+
** khpxuqmniqbqev-uhfffaoysa-l
* centisome-position:
+
* molecular-weight:
** 25.313875   
+
** 130.057
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[ASPAMINOTRANS-RXN]]
== Reaction(s) associated ==
+
* [[CITSYN-RXN]]
* [[3.4.19.12-RXN]]
+
* [[CSm]]
** Category: [[annotation]]
+
* [[MALATE-DEH-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[MALATE-DEHYDROGENASE-NADP+-RXN]]
{{#set: transcription-direction=negative}}
+
* [[OAAAKGtm]]
{{#set: right-end-position=324679}}
+
* [[OAACITtm]]
{{#set: left-end-position=288785}}
+
* [[OXALODECARB-RXN]]
{{#set: centisome-position=25.313875    }}
+
* [[PCr]]
{{#set: organism associated=S.japonica_carotenoid_curated}}
+
* [[PEPCARBOXYKIN-RXN]]
{{#set: nb reaction associated=1}}
+
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[RXN-13697]]
 +
* [[RXN-2464]]
 +
== Reaction(s) known to produce the compound ==
 +
* [[ASPAMINOTRANS-RXN]]
 +
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
 +
* [[ATPCL]]
 +
* [[MALATE-DEH-RXN]]
 +
* [[OAAAKGtm]]
 +
* [[OAACITtm]]
 +
* [[OXALOACETATE-TAUTOMERASE-RXN]]
 +
* [[PCr]]
 +
* [[PEPCARBOX-RXN]]
 +
* [[PPC]]
 +
* [[PREPHENATE-ASP-TRANSAMINE-RXN]]
 +
* [[PYRUVATE-CARBOXYLASE-RXN]]
 +
* [[RXN-13697]]
 +
* [[RXN-2464]]
 +
== Reaction(s) of unknown directionality ==
 +
{{#set: common-name=oxaloacetate}}
 +
{{#set: inchi-key=inchikey=khpxuqmniqbqev-uhfffaoysa-l}}
 +
{{#set: molecular-weight=130.057}}

Latest revision as of 11:11, 18 March 2021