Difference between revisions of "MANNITOL-1P"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ16288 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * RR-BUTANEDIOL-DEHYDROGEN...") |
(Created page with "Category:metabolite == Metabolite MANNITOL-1P == * common-name: ** d-mannitol 1-phosphate * smiles: ** c(c(c(c(c(cop([o-])([o-])=o)o)o)o)o)o * inchi-key: ** gactwzzmvmukng...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite MANNITOL-1P == |
− | + | * common-name: | |
− | * | + | ** d-mannitol 1-phosphate |
− | == Reaction(s) | + | * smiles: |
− | * [[ | + | ** c(c(c(c(c(cop([o-])([o-])=o)o)o)o)o)o |
− | * | + | * inchi-key: |
− | + | ** gactwzzmvmukng-kvtdhhqdsa-l | |
− | == | + | * molecular-weight: |
− | * [[ | + | ** 260.137 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[MANNITOL-1-PHOSPHATASE-RXN]] | |
− | + | * [[MANNPDEHYDROG-RXN]] | |
− | {{#set: | + | == Reaction(s) known to produce the compound == |
− | {{#set: | + | * [[MANNPDEHYDROG-RXN]] |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
+ | {{#set: common-name=d-mannitol 1-phosphate}} | ||
+ | {{#set: inchi-key=inchikey=gactwzzmvmukng-kvtdhhqdsa-l}} | ||
+ | {{#set: molecular-weight=260.137}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite MANNITOL-1P
- common-name:
- d-mannitol 1-phosphate
- smiles:
- c(c(c(c(c(cop([o-])([o-])=o)o)o)o)o)o
- inchi-key:
- gactwzzmvmukng-kvtdhhqdsa-l
- molecular-weight:
- 260.137