|
|
| (7 intermediate revisions by 3 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:gene]] | + | [[Category:metabolite]] |
| − | == Gene SJ01012 == | + | == Metabolite CPD-535 == |
| − | * transcription-direction: | + | * common-name: |
| − | ** positive | + | ** β-d-fructose 2,6-bisphosphate |
| − | * right-end-position:
| + | * smiles: |
| − | ** 17442
| + | ** c(c1(oc(c(c1o)o)(co)op([o-])([o-])=o))op(=o)([o-])[o-] |
| − | * left-end-position:
| + | * inchi-key: |
| − | ** 647 | + | ** yxwoajxnvlxpmu-zxxmmsqzsa-j |
| − | * centisome-position:
| + | * molecular-weight: |
| − | ** 0.40875638 | + | ** 336.085 |
| − | == Organism(s) associated with this gene ==
| + | == Reaction(s) known to consume the compound == |
| − | * [[S.japonica_carotenoid_curated]]
| + | * [[3.1.3.46-RXN]] |
| − | == Reaction(s) associated == | + | == Reaction(s) known to produce the compound == |
| − | * [[RXN-14971]]
| + | * [[6-PHOSPHOFRUCTO-2-KINASE-RXN]] |
| − | ** Category: [[annotation]]
| + | == Reaction(s) of unknown directionality == |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | + | {{#set: common-name=β-d-fructose 2,6-bisphosphate}} |
| − | ** Category: [[orthology]]
| + | {{#set: inchi-key=inchikey=yxwoajxnvlxpmu-zxxmmsqzsa-j}} |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| + | {{#set: molecular-weight=336.085}} |
| − | * [[RXN-15378]]
| |
| − | ** Category: [[annotation]]
| |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a | |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
| |
| − | ** Category: [[annotation]] | |
| − | *** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
| |
| − | * [[SUCDH_LPAREN_q8_RPAREN_m]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a | |
| − | == Pathway(s) associated == | |
| − | <div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
| |
| − | * [[PWY-6969]] | |
| − | ** '''10''' reactions found over '''12''' reactions in the full pathway
| |
| − | * [[PWY-5690]]
| |
| − | ** '''8''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[P105-PWY]] | |
| − | ** '''10''' reactions found over '''11''' reactions in the full pathway
| |
| − | * [[TCA]]
| |
| − | ** '''9''' reactions found over '''10''' reactions in the full pathway
| |
| − | * [[PWY-7254]]
| |
| − | ** '''7''' reactions found over '''9''' reactions in the full pathway
| |
| − | * [[PWY-561]]
| |
| − | ** '''6''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-6728]]
| |
| − | ** '''11''' reactions found over '''19''' reactions in the full pathway
| |
| − | * [[PWY-3781]]
| |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY-7279]]
| |
| − | ** '''4''' reactions found over '''4''' reactions in the full pathway
| |
| − | * [[PWY66-398]]
| |
| − | ** '''10''' reactions found over '''11''' reactions in the full pathway
| |
| − | * [[PWY-4302]]
| |
| − | ** '''3''' reactions found over '''3''' reactions in the full pathway
| |
| − | * [[PWY0-1329]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | * [[PWY0-1353]]
| |
| − | ** '''1''' reactions found over '''2''' reactions in the full pathway
| |
| − | </div>
| |
| − | {{#set: transcription-direction=positive}} | |
| − | {{#set: right-end-position=17442}} | |
| − | {{#set: left-end-position=647}}
| |
| − | {{#set: centisome-position=0.40875638 }} | |
| − | {{#set: organism associated=S.japonica_carotenoid_curated}}
| |
| − | {{#set: nb reaction associated=4}}
| |
| − | {{#set: nb pathway associated=13}}
| |
