Difference between revisions of "CPD1F-133"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ05859 == * transcription-direction: ** positive * right-end-position: ** 21314 * left-end-position: ** 8365 * centisome-position: ** 9.608868 =...")
(Created page with "Category:metabolite == Metabolite CPD1F-133 == * common-name: ** violaxanthin * smiles: ** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc34(c(c)(c)cc(...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ05859 ==
+
== Metabolite CPD1F-133 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** violaxanthin
−
* right-end-position:
+
* smiles:
−
** 21314
+
** cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc34(c(c)(c)cc(o)cc(o3)(c)4)
−
* left-end-position:
+
* inchi-key:
−
** 8365
+
** szcbxwmuopqsox-wvjdlnglsa-n
−
* centisome-position:
+
* molecular-weight:
−
** 9.608868   
+
** 600.88
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-13185]]
−
== Reaction(s) associated ==
+
* [[RXN-7984]]
−
* [[ARACHIDONATE-5-LIPOXYGENASE-RXN]]
+
* [[RXN1F-155]]
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-13185]]
−
* [[RXN-1321]]
+
* [[RXN-7979]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=violaxanthin}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=szcbxwmuopqsox-wvjdlnglsa-n}}
−
* [[RXN-13395]]
+
{{#set: molecular-weight=600.88}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-8497]]
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-8647]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY66-375]]
 
−
** '''5''' reactions found over '''6''' reactions in the full pathway
 
−
* [[PWY-5410]]
 
−
** '''2''' reactions found over '''9''' reactions in the full pathway
 
−
* [[PWY-735]]
 
−
** '''16''' reactions found over '''19''' reactions in the full pathway
 
−
* [[PWY66-392]]
 
−
** '''1''' reactions found over '''11''' reactions in the full pathway
 
−
* [[PWY-6917]]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-5406]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5407]]
 
−
** '''1''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-5408]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=21314}}
 
−
{{#set: left-end-position=8365}}
 
−
{{#set: centisome-position=9.608868    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=8}}
 

Latest revision as of 11:11, 18 March 2021

Metabolite CPD1F-133

  • common-name:
    • violaxanthin
  • smiles:
    • cc(=cc=cc=c(c=cc=c(c)c=cc12(c(c)(c)cc(o)cc(o1)(c)2))c)c=cc=c(c)c=cc34(c(c)(c)cc(o)cc(o3)(c)4)
  • inchi-key:
    • szcbxwmuopqsox-wvjdlnglsa-n
  • molecular-weight:
    • 600.88

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD1F-133&oldid=137030"