Difference between revisions of "PHYTOL"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ16093 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite PHYTOL == * common-name: ** phytol * smiles: ** cc(c)cccc(c)cccc(c)cccc(c)=cco * inchi-key: ** botwfxyspfmfnr-pyddkjgssa-n * molecular-we...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite PHYTOL == |
| − | + | * common-name: | |
| − | * | + | ** phytol |
| − | + | * smiles: | |
| − | * | + | ** cc(c)cccc(c)cccc(c)cccc(c)=cco |
| − | ** | + | * inchi-key: |
| − | ** | + | ** botwfxyspfmfnr-pyddkjgssa-n |
| − | * [[RXN- | + | * molecular-weight: |
| − | * | + | ** 296.535 |
| − | + | == Reaction(s) known to consume the compound == | |
| − | == | + | * [[RXN-7683]] |
| − | + | * [[RXN66-478]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | {{#set: | + | {{#set: common-name=phytol}} |
| − | {{#set: | + | {{#set: inchi-key=inchikey=botwfxyspfmfnr-pyddkjgssa-n}} |
| + | {{#set: molecular-weight=296.535}} | ||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite PHYTOL
- common-name:
- phytol
- smiles:
- cc(c)cccc(c)cccc(c)cccc(c)=cco
- inchi-key:
- botwfxyspfmfnr-pyddkjgssa-n
- molecular-weight:
- 296.535
