Difference between revisions of "CPD-7280"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ20122 == * transcription-direction: ** positive * right-end-position: ** 94661 * left-end-position: ** 74480 * centisome-position: ** 34.97075...") |
(Created page with "Category:metabolite == Metabolite CPD-7280 == * common-name: ** (3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al * smiles: ** cc(c=cc=c(c)c=cc12(oc...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-7280 == |
− | * | + | * common-name: |
− | ** | + | ** (3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al |
− | + | * smiles: | |
− | + | ** cc(c=cc=c(c)c=cc12(oc(cc(o)cc(c)(c)1)2))=cc=cc=c(c)cc=o | |
− | + | * inchi-key: | |
− | + | ** fyydcjdefsyvoy-wenurhbksa-n | |
− | * | + | * molecular-weight: |
− | ** | + | ** 382.542 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == | + | * [[RXN-7973-CPD-7424/OXYGEN-MOLECULE//CPD-7279/CPD-7280.44.]] |
− | * | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=(3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al}} | |
− | ** | + | {{#set: inchi-key=inchikey=fyydcjdefsyvoy-wenurhbksa-n}} |
− | + | {{#set: molecular-weight=382.542}} | |
− | |||
− | |||
− | * | ||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-7280
- common-name:
- (3s,5r,6s)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al
- smiles:
- cc(c=cc=c(c)c=cc12(oc(cc(o)cc(c)(c)1)2))=cc=cc=c(c)cc=o
- inchi-key:
- fyydcjdefsyvoy-wenurhbksa-n
- molecular-weight:
- 382.542