Difference between revisions of "C1"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ12411 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * DIHYDRONEOPTERIN-MONO-P-...") |
(Created page with "Category:metabolite == Metabolite C1 == * common-name: ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine * smiles:...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite C1 == |
− | + | * common-name: | |
− | * | + | ** udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine |
− | + | * smiles: | |
− | * | + | ** cc(c(=o)nc(c)c([o-])=o)nc(=o)c(cccc([n+])c(=o)[o-])nc(=o)ccc(c(=o)[o-])nc(=o)c(c)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op([o-])(op([o-])(occ2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3)))=o)=o) |
− | * | + | * inchi-key: |
− | ** | + | ** imwoxezvyqdrdf-mczxnmlpsa-j |
− | + | * molecular-weight: | |
− | + | ** 1189.924 | |
− | + | == Reaction(s) known to consume the compound == | |
− | == | + | * [[PHOSNACMURPENTATRANS-RXN]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | ** | + | == Reaction(s) of unknown directionality == |
− | * | + | {{#set: common-name=udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine}} |
− | ** | + | {{#set: inchi-key=inchikey=imwoxezvyqdrdf-mczxnmlpsa-j}} |
− | * [[ | + | {{#set: molecular-weight=1189.924}} |
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | {{#set: |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite C1
- common-name:
- udp-n-acetyl-α-d-muramoyl-l-alanyl-γ-d-glutamyl-meso-2,6-diaminopimeloyl-d-alanyl-d-alanine
- smiles:
- cc(c(=o)nc(c)c([o-])=o)nc(=o)c(cccc([n+])c(=o)[o-])nc(=o)ccc(c(=o)[o-])nc(=o)c(c)nc(=o)c(c)oc1(c(o)c(co)oc(c(nc(=o)c)1)op([o-])(op([o-])(occ2(c(o)c(o)c(o2)n3(c=cc(=o)nc(=o)3)))=o)=o)
- inchi-key:
- imwoxezvyqdrdf-mczxnmlpsa-j
- molecular-weight:
- 1189.924