Difference between revisions of "CPD-510"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ00668 == * transcription-direction: ** positive * right-end-position: ** 138361 * left-end-position: ** 120624 * centisome-position: ** 73.64282...") |
(Created page with "Category:metabolite == Metabolite CPD-510 == * common-name: ** α-d-glucuronate 1-phosphate * smiles: ** c(c1(oc(c(c(c1o)o)o)op([o-])([o-])=o))([o-])=o * inchi-key: *...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-510 == |
| − | * | + | * common-name: |
| − | ** | + | ** α-d-glucuronate 1-phosphate |
| − | * | + | * smiles: |
| − | ** | + | ** c(c1(oc(c(c(c1o)o)o)op([o-])([o-])=o))([o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** aiqdykmwenwvqj-qiuujyrfsa-k |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 271.097 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[2.7.7.44-RXN]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[2.7.7.44-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=α-d-glucuronate 1-phosphate}} | |
| − | + | {{#set: inchi-key=inchikey=aiqdykmwenwvqj-qiuujyrfsa-k}} | |
| − | + | {{#set: molecular-weight=271.097}} | |
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-510
- common-name:
- α-d-glucuronate 1-phosphate
- smiles:
- c(c1(oc(c(c(c1o)o)o)op([o-])([o-])=o))([o-])=o
- inchi-key:
- aiqdykmwenwvqj-qiuujyrfsa-k
- molecular-weight:
- 271.097
