Difference between revisions of "DGMP"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ09657 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * PROTEIN-KINASE-RXN **...") |
(Created page with "Category:metabolite == Metabolite DGMP == * common-name: ** dgmp * smiles: ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) * inchi-key: ** ltfmzdnnppeqng-k...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite DGMP == |
| − | == | + | * common-name: |
| − | * [[ | + | ** dgmp |
| − | == Reaction(s) | + | * smiles: |
| − | * [[ | + | ** c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23))) |
| − | ** | + | * inchi-key: |
| − | * | + | ** ltfmzdnnppeqng-kvqbguixsa-l |
| − | {{#set: | + | * molecular-weight: |
| − | {{#set: | + | ** 345.208 |
| + | == Reaction(s) known to consume the compound == | ||
| + | * [[ATDGM]] | ||
| + | * [[DMPH]] | ||
| + | == Reaction(s) known to produce the compound == | ||
| + | * [[DGTD]] | ||
| + | * [[DMPH]] | ||
| + | * [[RXN-14208]] | ||
| + | * [[RXN-14218]] | ||
| + | * [[RXN0-385]] | ||
| + | == Reaction(s) of unknown directionality == | ||
| + | {{#set: common-name=dgmp}} | ||
| + | {{#set: inchi-key=inchikey=ltfmzdnnppeqng-kvqbguixsa-l}} | ||
| + | {{#set: molecular-weight=345.208}} | ||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite DGMP
- common-name:
- dgmp
- smiles:
- c(op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- ltfmzdnnppeqng-kvqbguixsa-l
- molecular-weight:
- 345.208
