Difference between revisions of "CPD-476"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ06070 == * transcription-direction: ** negative * right-end-position: ** 53495 * left-end-position: ** 4662 * centisome-position: ** 5.532087 =...") |
(Created page with "Category:metabolite == Metabolite CPD-476 == * common-name: ** 4-(2-aminophenyl)-2,4-dioxobutanoate * smiles: ** c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o * inchi-key: ** cao...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-476 == |
| − | * | + | * common-name: |
| − | ** | + | ** 4-(2-aminophenyl)-2,4-dioxobutanoate |
| − | * | + | * smiles: |
| − | ** | + | ** c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o |
| − | * | + | * inchi-key: |
| − | ** | + | ** caovwyzqmpnafj-uhfffaoysa-m |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 206.177 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[2.6.1.7-RXN]] |
| − | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[2.6.1.7-RXN]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=4-(2-aminophenyl)-2,4-dioxobutanoate}} | |
| − | + | {{#set: inchi-key=inchikey=caovwyzqmpnafj-uhfffaoysa-m}} | |
| − | + | {{#set: molecular-weight=206.177}} | |
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-476
- common-name:
- 4-(2-aminophenyl)-2,4-dioxobutanoate
- smiles:
- c(c(cc(c1(c(=cc=cc=1)n))=o)=o)([o-])=o
- inchi-key:
- caovwyzqmpnafj-uhfffaoysa-m
- molecular-weight:
- 206.177
