Difference between revisions of "IMIDAZOLE-ACETOL-P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ03218 == * transcription-direction: ** positive * right-end-position: ** 111043 * left-end-position: ** 82690 * centisome-position: ** 67.08801...")
(Created page with "Category:metabolite == Metabolite IMIDAZOLE-ACETOL-P == * common-name: ** imidazole acetol-phosphate * smiles: ** c1(nc=nc=1cc(cop([o-])(=o)[o-])=o) * inchi-key: ** ycffms...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ03218 ==
+
== Metabolite IMIDAZOLE-ACETOL-P ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** imidazole acetol-phosphate
−
* right-end-position:
+
* smiles:
−
** 111043
+
** c1(nc=nc=1cc(cop([o-])(=o)[o-])=o)
−
* left-end-position:
+
* inchi-key:
−
** 82690
+
** ycffmsolumramd-uhfffaoysa-l
−
* centisome-position:
+
* molecular-weight:
−
** 67.08801   
+
** 218.105
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[HISTAMINOTRANS-RXN]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[HISTAMINOTRANS-RXN]]
−
* [[PEROXID-RXN]]
+
* [[IGPD]]
−
** Category: [[annotation]]
+
* [[IMIDPHOSDEHYD-RXN]]
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
−
** Category: [[orthology]]
+
{{#set: common-name=imidazole acetol-phosphate}}
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=ycffmsolumramd-uhfffaoysa-l}}
−
* [[RXN-14240]]
+
{{#set: molecular-weight=218.105}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-15288]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-17352]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* [[RXN-8635]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
** Category: [[orthology]]
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
</div>
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7214]]
 
−
** '''1''' reactions found over '''2''' reactions in the full pathway
 
−
* [[PWY-7445]]
 
−
** '''1''' reactions found over '''4''' reactions in the full pathway
 
−
* [[PWY-5466]]
 
−
** '''2''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-6824]]
 
−
** '''2''' reactions found over '''10''' reactions in the full pathway
 
−
* [[PWY-5469]]
 
−
** '''2''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-5461]]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=111043}}
 
−
{{#set: left-end-position=82690}}
 
−
{{#set: centisome-position=67.08801    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=5}}
 
−
{{#set: nb pathway associated=6}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite IMIDAZOLE-ACETOL-P

  • common-name:
    • imidazole acetol-phosphate
  • smiles:
    • c1(nc=nc=1cc(cop([o-])(=o)[o-])=o)
  • inchi-key:
    • ycffmsolumramd-uhfffaoysa-l
  • molecular-weight:
    • 218.105

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=IMIDAZOLE-ACETOL-P&oldid=137692"