Difference between revisions of "CPD-14407"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ07942 == * transcription-direction: ** positive * right-end-position: ** 151010 * left-end-position: ** 139086 * centisome-position: ** 31.089634...")
(Created page with "Category:metabolite == Metabolite CPD-14407 == * common-name: ** dihomo γ-linolenoyl-coa * smiles: ** cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ07942 ==
+
== Metabolite CPD-14407 ==
* transcription-direction:
+
* common-name:
** positive
+
** dihomo γ-linolenoyl-coa
* right-end-position:
+
* smiles:
** 151010
+
** cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 139086
+
** fjwjalrunnzibb-ddquopdjsa-j
* centisome-position:
+
* molecular-weight:
** 31.089634   
+
** 1051.975
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-13435]]
== Reaction(s) associated ==
+
* [[RXN-16044]]
* [[TRNA-GUANINE-N7--METHYLTRANSFERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[RXN-12971]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[RXN-17105]]
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: common-name=dihomo γ-linolenoyl-coa}}
{{#set: transcription-direction=positive}}
+
{{#set: inchi-key=inchikey=fjwjalrunnzibb-ddquopdjsa-j}}
{{#set: right-end-position=151010}}
+
{{#set: molecular-weight=1051.975}}
{{#set: left-end-position=139086}}
 
{{#set: centisome-position=31.089634    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-14407

  • common-name:
    • dihomo γ-linolenoyl-coa
  • smiles:
    • cccccc=ccc=ccc=cccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • fjwjalrunnzibb-ddquopdjsa-j
  • molecular-weight:
    • 1051.975

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality