Difference between revisions of "GALACTOSE-1P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ17385 == * transcription-direction: ** positive * right-end-position: ** 251506 * left-end-position: ** 237403 * centisome-position: ** 69.50184...")
(Created page with "Category:metabolite == Metabolite GALACTOSE-1P == * common-name: ** α-d-galactose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: **...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ17385 ==
+
== Metabolite GALACTOSE-1P ==
* transcription-direction:
+
* common-name:
** positive
+
** α-d-galactose 1-phosphate
* right-end-position:
+
* smiles:
** 251506
+
** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
* left-end-position:
+
* inchi-key:
** 237403
+
** hxxfsfrbohsimq-fprjbgldsa-l
* centisome-position:
+
* molecular-weight:
** 69.50184   
+
** 258.121
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
* [[GALACTOKIN-RXN]]
== Reaction(s) associated ==
+
* [[GALACTURIDYLYLTRANS-RXN]]
* [[DIHYDROFOLATEREDUCT-RXN]]
+
* [[UTPHEXPURIDYLYLTRANS-RXN]]
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
* [[GALACTOKIN-RXN]]
* [[METHENYLTHFCYCLOHYDRO-RXN]]
+
* [[GALACTURIDYLYLTRANS-RXN]]
** Category: [[annotation]]
+
* [[UTPHEXPURIDYLYLTRANS-RXN]]
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
== Reaction(s) of unknown directionality ==
** Category: [[orthology]]
+
{{#set: common-name=α-d-galactose 1-phosphate}}
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
{{#set: inchi-key=inchikey=hxxfsfrbohsimq-fprjbgldsa-l}}
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
+
{{#set: molecular-weight=258.121}}
** Category: [[annotation]]
 
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
* [[MTHFCx]]
 
** Category: [[orthology]]
 
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
== Pathway(s) associated ==
 
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[1CMET2-PWY]]
 
** '''8''' reactions found over '''9''' reactions in the full pathway
 
* [[PWY-3841]]
 
** '''9''' reactions found over '''11''' reactions in the full pathway
 
* [[PWY-6614]]
 
** '''3''' reactions found over '''3''' reactions in the full pathway
 
* [[PWY-5497]]
 
** '''10''' reactions found over '''24''' reactions in the full pathway
 
* [[P164-PWY]]
 
** '''6''' reactions found over '''17''' reactions in the full pathway
 
* [[CODH-PWY]]
 
** '''4''' reactions found over '''9''' reactions in the full pathway
 
* [[PWY-5030]]
 
** '''3''' reactions found over '''6''' reactions in the full pathway
 
* [[PWY-7909]]
 
** '''3''' reactions found over '''4''' reactions in the full pathway
 
* [[PWY-2201]]
 
** '''9''' reactions found over '''12''' reactions in the full pathway
 
* [[PWY-6613]]
 
** '''2''' reactions found over '''2''' reactions in the full pathway
 
* [[PWY-1722]]
 
** '''3''' reactions found over '''3''' reactions in the full pathway
 
</div>
 
{{#set: transcription-direction=positive}}
 
{{#set: right-end-position=251506}}
 
{{#set: left-end-position=237403}}
 
{{#set: centisome-position=69.50184    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=4}}
 
{{#set: nb pathway associated=11}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite GALACTOSE-1P

  • common-name:
    • α-d-galactose 1-phosphate
  • smiles:
    • c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
  • inchi-key:
    • hxxfsfrbohsimq-fprjbgldsa-l
  • molecular-weight:
    • 258.121

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality