Difference between revisions of "GALACTOSE-1P"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ17385 == * transcription-direction: ** positive * right-end-position: ** 251506 * left-end-position: ** 237403 * centisome-position: ** 69.50184...") |
(Created page with "Category:metabolite == Metabolite GALACTOSE-1P == * common-name: ** α-d-galactose 1-phosphate * smiles: ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) * inchi-key: **...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite GALACTOSE-1P == |
− | * | + | * common-name: |
− | ** | + | ** α-d-galactose 1-phosphate |
− | + | * smiles: | |
− | + | ** c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1) | |
− | + | * inchi-key: | |
− | + | ** hxxfsfrbohsimq-fprjbgldsa-l | |
− | * | + | * molecular-weight: |
− | ** | + | ** 258.121 |
− | + | == Reaction(s) known to consume the compound == | |
− | + | * [[GALACTOKIN-RXN]] | |
− | + | * [[GALACTURIDYLYLTRANS-RXN]] | |
− | + | * [[UTPHEXPURIDYLYLTRANS-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[GALACTOKIN-RXN]] | |
− | * | + | * [[GALACTURIDYLYLTRANS-RXN]] |
− | + | * [[UTPHEXPURIDYLYLTRANS-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | ** | + | {{#set: common-name=α-d-galactose 1-phosphate}} |
− | + | {{#set: inchi-key=inchikey=hxxfsfrbohsimq-fprjbgldsa-l}} | |
− | + | {{#set: molecular-weight=258.121}} | |
− | * | ||
− | |||
− | |||
− | ** | ||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite GALACTOSE-1P
- common-name:
- α-d-galactose 1-phosphate
- smiles:
- c(o)c1(oc(op(=o)([o-])[o-])c(o)c(o)c(o)1)
- inchi-key:
- hxxfsfrbohsimq-fprjbgldsa-l
- molecular-weight:
- 258.121