Difference between revisions of "CPD-13014"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ04996 == * transcription-direction: ** negative * right-end-position: ** 102342 * left-end-position: ** 90912 * centisome-position: ** 9.414747...") |
(Created page with "Category:metabolite == Metabolite CPD-13014 == * common-name: ** tributyrin * smiles: ** cccc(occ(oc(ccc)=o)coc(ccc)=o)=o * inchi-key: ** uyxtwwcetriedr-uhfffaoysa-n * mol...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-13014 == |
− | * | + | * common-name: |
− | ** | + | ** tributyrin |
− | * | + | * smiles: |
− | ** | + | ** cccc(occ(oc(ccc)=o)coc(ccc)=o)=o |
− | * | + | * inchi-key: |
− | ** | + | ** uyxtwwcetriedr-uhfffaoysa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 302.367 |
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-12086]] |
− | == Reaction(s) | + | == Reaction(s) known to produce the compound == |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=tributyrin}} | |
− | + | {{#set: inchi-key=inchikey=uyxtwwcetriedr-uhfffaoysa-n}} | |
− | + | {{#set: molecular-weight=302.367}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:13, 18 March 2021
Contents
Metabolite CPD-13014
- common-name:
- tributyrin
- smiles:
- cccc(occ(oc(ccc)=o)coc(ccc)=o)=o
- inchi-key:
- uyxtwwcetriedr-uhfffaoysa-n
- molecular-weight:
- 302.367