Difference between revisions of "CPD-8890"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ11751 == * transcription-direction: ** negative * right-end-position: ** 207893 * left-end-position: ** 199791 * centisome-position: ** 54.41346...") |
(Created page with "Category:metabolite == Metabolite CPD-8890 == * common-name: ** betanidin quinone * smiles: ** c(=[n+]1(c(c([o-])=o)cc2(c1=cc(=o)c(=o)c=2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-8890 == |
| − | * | + | * common-name: |
| − | ** | + | ** betanidin quinone |
| − | * | + | * smiles: |
| − | ** | + | ** c(=[n+]1(c(c([o-])=o)cc2(c1=cc(=o)c(=o)c=2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3) |
| − | * | + | * inchi-key: |
| − | ** | + | ** mcthlmsflmebek-aaeuagobsa-l |
| − | * | + | * molecular-weight: |
| − | ** | + | ** 384.301 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN-8635]] |
| − | * [[RXN- | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=betanidin quinone}} | |
| − | + | {{#set: inchi-key=inchikey=mcthlmsflmebek-aaeuagobsa-l}} | |
| − | + | {{#set: molecular-weight=384.301}} | |
| − | |||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-8890
- common-name:
- betanidin quinone
- smiles:
- c(=[n+]1(c(c([o-])=o)cc2(c1=cc(=o)c(=o)c=2)))c=c3(c=c(c(=o)[o-])nc(c([o-])=o)c3)
- inchi-key:
- mcthlmsflmebek-aaeuagobsa-l
- molecular-weight:
- 384.301
