Difference between revisions of "CPD-12115"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ06532 == * transcription-direction: ** positive * right-end-position: ** 18975 * left-end-position: ** 17058 * centisome-position: ** 21.896742...") |
(Created page with "Category:metabolite == Metabolite CPD-12115 == * common-name: ** demethylmenaquinol-8 * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o...") |
||
| (7 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-12115 == |
| − | * | + | * common-name: |
| − | ** | + | ** demethylmenaquinol-8 |
| − | + | * smiles: | |
| − | + | ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2)) | |
| − | * | + | * inchi-key: |
| − | ** | + | ** fgypgicsxjekcg-aendiincsa-n |
| − | + | * molecular-weight: | |
| − | + | ** 705.118 | |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[ADOMET-DMK-METHYLTRANSFER-RXN]] | |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | * | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=demethylmenaquinol-8}} | |
| − | ** | + | {{#set: inchi-key=inchikey=fgypgicsxjekcg-aendiincsa-n}} |
| − | + | {{#set: molecular-weight=705.118}} | |
| − | |||
| − | |||
| − | * | ||
| − | |||
| − | ** | ||
| − | == | ||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-12115
- common-name:
- demethylmenaquinol-8
- smiles:
- cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c=c(o)c2(c=cc=cc(c(o)=1)=2))
- inchi-key:
- fgypgicsxjekcg-aendiincsa-n
- molecular-weight:
- 705.118
