Difference between revisions of "SULFO-CYSTEINE"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ01095 == == Organism(s) associated with this gene == * S.japonica_carotenoid_curated == Reaction(s) associated == * 4.2.2.10-RXN ** Catego...") |
(Created page with "Category:metabolite == Metabolite SULFO-CYSTEINE == * common-name: ** s-sulfo-l-cysteine * smiles: ** c(c([n+])c(=o)[o-])ss([o-])(=o)=o * inchi-key: ** nokpbjyhphhwan-reoh...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite SULFO-CYSTEINE == |
− | + | * common-name: | |
− | * | + | ** s-sulfo-l-cysteine |
− | + | * smiles: | |
− | + | ** c(c([n+])c(=o)[o-])ss([o-])(=o)=o | |
− | * | + | * inchi-key: |
− | ** | + | ** nokpbjyhphhwan-reohclbhsa-m |
− | * | + | * molecular-weight: |
− | * | + | ** 200.204 |
− | *** | + | == Reaction(s) known to consume the compound == |
− | == | + | * [[SULFOCYS-RXN]] |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[SULFOCYS-RXN]] | |
− | {{#set: | + | == Reaction(s) of unknown directionality == |
− | {{#set: | + | {{#set: common-name=s-sulfo-l-cysteine}} |
− | {{#set: | + | {{#set: inchi-key=inchikey=nokpbjyhphhwan-reohclbhsa-m}} |
+ | {{#set: molecular-weight=200.204}} |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite SULFO-CYSTEINE
- common-name:
- s-sulfo-l-cysteine
- smiles:
- c(c([n+])c(=o)[o-])ss([o-])(=o)=o
- inchi-key:
- nokpbjyhphhwan-reohclbhsa-m
- molecular-weight:
- 200.204