Difference between revisions of "CPD-13227"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ12736 == * transcription-direction: ** negative * right-end-position: ** 147811 * left-end-position: ** 141562 * centisome-position: ** 19.058352...") |
(Created page with "Category:metabolite == Metabolite CPD-13227 == * common-name: ** n,n',n''-triacetylchitotriose * smiles: ** cc(=o)nc1(c(o)oc(co)c(c(o)1)oc2(c(nc(c)=o)c(o)c(c(co)o2)oc3(oc(...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-13227 == |
− | * | + | * common-name: |
− | ** | + | ** n,n',n''-triacetylchitotriose |
− | * | + | * smiles: |
− | ** | + | ** cc(=o)nc1(c(o)oc(co)c(c(o)1)oc2(c(nc(c)=o)c(o)c(c(co)o2)oc3(oc(c(o)c(o)c(nc(c)=o)3)co))) |
− | * | + | * inchi-key: |
− | ** | + | ** wzzvuhwlnmnwlw-mewklcdlsa-n |
− | * | + | * molecular-weight: |
− | ** | + | ** 627.598 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[RXN-12623]] |
− | * [[ | + | * [[RXN-12624]] |
− | + | == Reaction(s) of unknown directionality == | |
− | + | {{#set: common-name=n,n',n''-triacetylchitotriose}} | |
− | + | {{#set: inchi-key=inchikey=wzzvuhwlnmnwlw-mewklcdlsa-n}} | |
− | + | {{#set: molecular-weight=627.598}} | |
− | |||
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite CPD-13227
- common-name:
- n,n',n-triacetylchitotriose
- smiles:
- cc(=o)nc1(c(o)oc(co)c(c(o)1)oc2(c(nc(c)=o)c(o)c(c(co)o2)oc3(oc(c(o)c(o)c(nc(c)=o)3)co)))
- inchi-key:
- wzzvuhwlnmnwlw-mewklcdlsa-n
- molecular-weight:
- 627.598