Difference between revisions of "TREHALOSE-6P"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-602 RXN-602] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/1.14...")
(Created page with "Category:metabolite == Metabolite TREHALOSE-6P == * common-name: ** α,α-trehalose 6-phosphate * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-]...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-602 RXN-602] ==
+
== Metabolite TREHALOSE-6P ==
−
* direction:
+
* common-name:
−
** left-to-right
+
** α,α-trehalose 6-phosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.14.11.19 ec-1.14.11.19]
+
** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-])o)o)o)))o
−
* synonymous:
+
* inchi-key:
−
** leucoanthocyanidin dioxygenase
+
** labspybhmpdtel-lizsdcnhsa-l
−
== Reaction formula ==
+
* molecular-weight:
−
* 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[CPD-590]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-19726]][c] '''+''' 1 [[SUC]][c] '''+''' 1 [[WATER]][c]
+
** 420.263
−
== Gene(s) associated with this reaction  ==
+
== Reaction(s) known to consume the compound ==
−
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
+
* [[TREHALOSEPHOSPHA-RXN]]
−
* Gene: [[SJ14675]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[orthology]]
+
* [[TREHALOSE6PSYN-RXN]]
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[UG6PGT]]
−
* Gene: [[SJ07557]]
+
* [[UG6PGTn]]
−
** Category: [[orthology]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: common-name=&alpha;,&alpha;-trehalose 6-phosphate}}
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
{{#set: inchi-key=inchikey=labspybhmpdtel-lizsdcnhsa-l}}
−
* Gene: [[SJ14670]]
+
{{#set: molecular-weight=420.263}}
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ14677]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ14672]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
* Gene: [[SJ08018]]
 
−
** Category: [[orthology]]
 
−
*** Source: [[output_pantograph_arabidopsis_thaliana]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
 
−
</div>
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R05036 R05036]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: ec-number=ec-1.14.11.19}}
 
−
{{#set: synonymous=leucoanthocyanidin dioxygenase}}
 
−
{{#set: nb gene associated=6}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=orthology}}
 
−
{{#set: reconstruction tool=pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|output_pantograph_arabidopsis_thaliana}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite TREHALOSE-6P

  • common-name:
    • α,α-trehalose 6-phosphate
  • smiles:
    • c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(o2)cop([o-])(=o)[o-])o)o)o)))o
  • inchi-key:
    • labspybhmpdtel-lizsdcnhsa-l
  • molecular-weight:
    • 420.263

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=TREHALOSE-6P&oldid=138523"