Difference between revisions of "CPD-13205"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIAMIN-PYROPHOSPHOKINASE-RXN THIAMIN-PYROPHOSPHOKINASE-RXN] == * direction: ** left-to-right * com...")
(Created page with "Category:metabolite == Metabolite CPD-13205 == * common-name: ** cellotetraose * smiles: ** c(c(c(c(c(co)o)oc1(c(c(c(c(co)o1)oc2(c(c(c(c(co)o2)oc3(c(c(c(c(co)o3)o)o)o))o)o...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=THIAMIN-PYROPHOSPHOKINASE-RXN THIAMIN-PYROPHOSPHOKINASE-RXN] ==
+
== Metabolite CPD-13205 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** thiamine pyrophosphokinase
+
** cellotetraose
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/2.7.6.2 ec-2.7.6.2]
+
** c(c(c(c(c(co)o)oc1(c(c(c(c(co)o1)oc2(c(c(c(c(co)o2)oc3(c(c(c(c(co)o3)o)o)o))o)o))o)o))o)o)=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ATP]][c] '''+''' 1 [[THIAMINE]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[THIAMINE-PYROPHOSPHATE]][c]
+
** uyqjcpnsavwafu-zeuiethysa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ14636]]
+
** 666.583
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-12305]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
== Pathway(s) ==
+
{{#set: common-name=cellotetraose}}
−
* [[PWY-6907]], thiamine diphosphate biosynthesis III (Staphylococcus): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6907 PWY-6907]
+
{{#set: inchi-key=inchikey=uyqjcpnsavwafu-zeuiethysa-n}}
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
{{#set: molecular-weight=666.583}}
−
* [[PWY-6908]], thiamine diphosphate biosynthesis IV (eukaryotes): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6908 PWY-6908]
 
−
** '''2''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-7356]], thiamine salvage IV (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7356 PWY-7356]
 
−
** '''6''' reactions found over '''7''' reactions in the full pathway
 
−
* [[PWY-6898]], thiamine salvage III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6898 PWY-6898]
 
−
** '''1''' reactions found over '''1''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11577 11577]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R00619 R00619]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/P35202 P35202]
 
−
** [http://www.uniprot.org/uniprot/P41888 P41888]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=thiamine pyrophosphokinase}}
 
−
{{#set: ec-number=ec-2.7.6.2}}
 
−
{{#set: nb gene associated=1}}
 
−
{{#set: nb pathway associated=4}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-13205

  • common-name:
    • cellotetraose
  • smiles:
    • c(c(c(c(c(co)o)oc1(c(c(c(c(co)o1)oc2(c(c(c(c(co)o2)oc3(c(c(c(c(co)o3)o)o)o))o)o))o)o))o)o)=o
  • inchi-key:
    • uyqjcpnsavwafu-zeuiethysa-n
  • molecular-weight:
    • 666.583

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-13205&oldid=138623"