|
|
| (7 intermediate revisions by 2 users not shown) |
| Line 1: |
Line 1: |
| − | [[Category:reaction]] | + | [[Category:metabolite]] |
| − | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BIOTINLIG-RXN BIOTINLIG-RXN] == | + | == Metabolite CPD-14927 == |
| − | * direction:
| |
| − | ** left-to-right
| |
| | * common-name: | | * common-name: |
| − | ** biotin-[acetyl-coa-carboxylase] ligase | + | ** phytenate |
| − | * ec-number: | + | * smiles: |
| − | ** [http://enzyme.expasy.org/EC/6.3.4.15 ec-6.3.4.15] | + | ** cc(c)cccc(c)cccc(c)cccc(c)=cc(=o)[o-] |
| − | == Reaction formula ==
| + | * inchi-key: |
| − | * 1 [[ATP]][c] '''+''' 1 [[BCCP-L-lysine]][c] '''+''' 1 [[BIOTIN]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[BCCP-biotin-L-lysine]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[PROTON]][c]
| + | ** wdwbnnbrpveeod-pfxvradusa-m |
| − | == Gene(s) associated with this reaction == | + | * molecular-weight: |
| − | * Gene: [[SJ10816]]
| + | ** 309.511 |
| − | ** Category: [[annotation]] | + | == Reaction(s) known to consume the compound == |
| − | *** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a | + | * [[RXN66-480]] |
| − | ** Category: [[orthology]] | + | == Reaction(s) known to produce the compound == |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | * [[RXN66-479]] |
| − | * Gene: [[SJ06657]]
| + | == Reaction(s) of unknown directionality == |
| − | ** Category: [[orthology]]
| + | {{#set: common-name=phytenate}} |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| + | {{#set: inchi-key=inchikey=wdwbnnbrpveeod-pfxvradusa-m}} |
| − | * Gene: [[SJ19949]]
| + | {{#set: molecular-weight=309.511}} |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
| |
| − | * Gene: [[SJ07132]]
| |
| − | ** Category: [[orthology]]
| |
| − | *** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a | |
| − | == Pathway(s) == | |
| − | * [[PWY0-1264]], biotin-carboxyl carrier protein assembly: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1264 PWY0-1264] | |
| − | ** '''3''' reactions found over '''4''' reactions in the full pathway
| |
| − | == Reconstruction information == | |
| − | * category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a | |
| − | * category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
| |
| − | == External links == | |
| − | * UNIPROT:
| |
| − | ** [http://www.uniprot.org/uniprot/P06709 P06709]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9PJ27 Q9PJ27]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CEQ6 Q9CEQ6]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9CED9 Q9CED9]
| |
| − | ** [http://www.uniprot.org/uniprot/Q9JWI7 Q9JWI7]
| |
| − | ** [http://www.uniprot.org/uniprot/P48445 P48445]
| |
| − | ** [http://www.uniprot.org/uniprot/P72816 P72816]
| |
| − | {{#set: direction=left-to-right}}
| |
| − | {{#set: common-name=biotin-[acetyl-coa-carboxylase] ligase}} | |
| − | {{#set: ec-number=ec-6.3.4.15}} | |
| − | {{#set: nb gene associated=4}} | |
| − | {{#set: nb pathway associated=1}}
| |
| − | {{#set: reconstruction category=annotation|orthology}}
| |
| − | {{#set: reconstruction tool=pantograph|pathwaytools}}
| |
| − | {{#set: reconstruction comment=n.a}}
| |
| − | {{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
| |
