Difference between revisions of "DIHYDROFOLATE"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DTMPKI-RXN DTMPKI-RXN] == * direction: ** left-to-right * common-name: ** dtmp kinase * ec-number:...") |
(Created page with "Category:metabolite == Metabolite DIHYDROFOLATE == * common-name: ** 7,8-dihydrofolate monoglutamate * smiles: ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=...") |
||
(7 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite DIHYDROFOLATE == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 7,8-dihydrofolate monoglutamate |
− | + | * smiles: | |
− | * | + | ** c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3)) |
− | ** [ | + | * inchi-key: |
− | + | ** ozrnssudzolusn-lbprgkrzsa-l | |
− | == | + | * molecular-weight: |
− | + | ** 441.402 | |
− | = | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[DHFR2i]] |
− | ** | + | * [[DHFRi]] |
− | * | + | * [[MDUMT]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[DHFOR]] | |
− | ** | + | * [[DIHYDROFOLATESYNTH-RXN]] |
− | == | + | * [[FOLR2]] |
− | * [[ | + | * [[MDUMT]] |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | {{#set: common-name=7,8-dihydrofolate monoglutamate}} |
− | + | {{#set: inchi-key=inchikey=ozrnssudzolusn-lbprgkrzsa-l}} | |
− | * [[ | + | {{#set: molecular-weight=441.402}} |
− | |||
− | |||
− | |||
− | |||
− | |||
− | * [[ | ||
− | |||
− | * [[ | ||
− | |||
− | |||
− | |||
− | * | ||
− | * | ||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: common-name= | ||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− | |||
− | |||
− | |||
− |
Latest revision as of 11:15, 18 March 2021
Contents
Metabolite DIHYDROFOLATE
- common-name:
- 7,8-dihydrofolate monoglutamate
- smiles:
- c(nc1(c=cc(c(=o)nc(c(=o)[o-])ccc([o-])=o)=cc=1))c3(cnc2(=c(c(=o)nc(n)=n2)n=3))
- inchi-key:
- ozrnssudzolusn-lbprgkrzsa-l
- molecular-weight:
- 441.402