Difference between revisions of "CPD-12932"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.3.56-RXN 3.1.3.56-RXN] == * direction: ** left-to-right * common-name: ** inositol-polyphosphat...")
(Created page with "Category:metabolite == Metabolite CPD-12932 == * common-name: ** all-trans-3,4-didehydrolycopene * smiles: ** cc(c)=cc=cc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.3.56-RXN 3.1.3.56-RXN] ==
+
== Metabolite CPD-12932 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** inositol-polyphosphate 5-phosphatase
+
** all-trans-3,4-didehydrolycopene
−
** ins(1,4,5)p3 5-phosphatase
+
* smiles:
−
** inositol-1,4,5-trisphosphate 5-phosphatase
+
** cc(c)=cc=cc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)ccc=c(c)c
−
* ec-number:
+
* inchi-key:
−
** [http://enzyme.expasy.org/EC/3.1.3.56 ec-3.1.3.56]
+
** ocmsupsdvxkdfy-fqmrbfjqsa-n
−
== Reaction formula ==
+
* molecular-weight:
−
* 1 [[INOSITOL-1-4-5-TRISPHOSPHATE]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[INOSITOL-1-4-BISPHOSPHATE]][c] '''+''' 1 [[Pi]][c]
+
** 534.867
−
== Gene(s) associated with this reaction  ==
+
== Reaction(s) known to consume the compound ==
−
* Gene: [[SJ12333]]
+
* [[RXN-11976]]
−
** Category: [[annotation]]
+
* [[RXN-11999]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* Gene: [[SJ20267]]
+
* [[RXN-12413]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=all-trans-3,4-didehydrolycopene}}
−
* Gene: [[SJ11565]]
+
{{#set: inchi-key=inchikey=ocmsupsdvxkdfy-fqmrbfjqsa-n}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=534.867}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
* Gene: [[SJ03588]]
 
−
** Category: [[annotation]]
 
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
 
−
== Pathway(s) ==
 
−
* [[PWY-6363]], D-myo-inositol (1,4,5)-trisphosphate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6363 PWY-6363]
 
−
** '''3''' reactions found over '''3''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19798 19798]
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R03394 R03394]
 
−
* UNIPROT:
 
−
** [http://www.uniprot.org/uniprot/O54996 O54996]
 
−
** [http://www.uniprot.org/uniprot/Q9FUR2 Q9FUR2]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=inositol-1,4,5-trisphosphate 5-phosphatase|ins(1,4,5)p3 5-phosphatase|inositol-polyphosphate 5-phosphatase}}
 
−
{{#set: ec-number=ec-3.1.3.56}}
 
−
{{#set: nb gene associated=4}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-12932

  • common-name:
    • all-trans-3,4-didehydrolycopene
  • smiles:
    • cc(c)=cc=cc(c)=cc=cc(c)=cc=cc(c)=cc=cc=c(c)c=cc=c(c)c=cc=c(c)ccc=c(c)c
  • inchi-key:
    • ocmsupsdvxkdfy-fqmrbfjqsa-n
  • molecular-weight:
    • 534.867

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-12932&oldid=138872"