Difference between revisions of "CPD-15152"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9598 RXN-9598] == * direction: ** left-to-right * common-name: ** monoamine oxidase * ec-number...")
(Created page with "Category:metabolite == Metabolite CPD-15152 == * common-name: ** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9598 RXN-9598] ==
+
== Metabolite CPD-15152 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** monoamine oxidase
+
** 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.4.3.4 ec-1.4.3.4]
+
** cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c=1)
== Reaction formula ==
+
* inchi-key:
* 1 [[Monoamines]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[Aldehydes]][c] '''+''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[Primary-Amines]][c]
+
** aftbilpwmusgin-mycgwmctsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ07831]]
+
** 683.068
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-14177]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone}}
== External links  ==
+
{{#set: inchi-key=inchikey=aftbilpwmusgin-mycgwmctsa-n}}
* RHEA:
+
{{#set: molecular-weight=683.068}}
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=26415 26415]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=monoamine oxidase}}
 
{{#set: ec-number=ec-1.4.3.4}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-15152

  • common-name:
    • 6-methoxy-2-all-trans-octaprenyl-1,4-benzoquinone
  • smiles:
    • cc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccc1(c(=o)c(oc)=cc(=o)c=1)
  • inchi-key:
    • aftbilpwmusgin-mycgwmctsa-n
  • molecular-weight:
    • 683.068

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality