Difference between revisions of "CPD-7526"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12380 RXN-12380] == * direction: ** left-to-right * common-name: ** trna (guanine27-n2-methyltr...")
(Created page with "Category:metabolite == Metabolite CPD-7526 == * common-name: ** 9,9'-di-cis-ζ-carotene * smiles: ** cc(=cccc(=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)...")
 
(7 intermediate revisions by 2 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12380 RXN-12380] ==
+
== Metabolite CPD-7526 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** trna (guanine27-n2-methyltransferase
+
** 9,9'-di-cis-ζ-carotene
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.1.1.215 ec-2.1.1.215]
+
** cc(=cccc(=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c
== Reaction formula ==
+
* inchi-key:
* 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[tRNA-Containing-N2-Dimethylgua-26-Gua27]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[tRNA-Containing-N2-Dimetgua-26-MeGua27]][c]
+
** biwlelkafxrpde-zurblsrnsa-n
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ14807]]
+
** 540.914
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-11354]]
* Gene: [[SJ09381]]
+
* [[RXN-11356]]
** Category: [[annotation]]
+
* [[RXN-12242]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
== Pathway(s) ==
+
* [[RXN-11354]]
== Reconstruction information  ==
+
== Reaction(s) of unknown directionality ==
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: common-name=9,9'-di-cis-ζ-carotene}}
== External links  ==
+
{{#set: inchi-key=inchikey=biwlelkafxrpde-zurblsrnsa-n}}
* RHEA:
+
{{#set: molecular-weight=540.914}}
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=43137 43137]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=trna (guanine27-n2-methyltransferase}}
 
{{#set: ec-number=ec-2.1.1.215}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=0}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-7526

  • common-name:
    • 9,9'-di-cis-ζ-carotene
  • smiles:
    • cc(=cccc(=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c
  • inchi-key:
    • biwlelkafxrpde-zurblsrnsa-n
  • molecular-weight:
    • 540.914

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality