Difference between revisions of "CPD-7526"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12380 RXN-12380] == * direction: ** left-to-right * common-name: ** trna (guanine27-n2-methyltr...") |
(Created page with "Category:metabolite == Metabolite CPD-7526 == * common-name: ** 9,9'-di-cis-ζ-carotene * smiles: ** cc(=cccc(=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)...") |
||
(7 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-7526 == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** 9,9'-di-cis-ζ-carotene |
− | * | + | * smiles: |
− | ** | + | ** cc(=cccc(=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c |
− | == | + | * inchi-key: |
− | + | ** biwlelkafxrpde-zurblsrnsa-n | |
− | = | + | * molecular-weight: |
− | * | + | ** 540.914 |
− | ** | + | == Reaction(s) known to consume the compound == |
− | ** | + | * [[RXN-11354]] |
− | * | + | * [[RXN-11356]] |
− | * | + | * [[RXN-12242]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | == | + | * [[RXN-11354]] |
− | + | == Reaction(s) of unknown directionality == | |
− | * | + | {{#set: common-name=9,9'-di-cis-ζ-carotene}} |
− | == | + | {{#set: inchi-key=inchikey=biwlelkafxrpde-zurblsrnsa-n}} |
− | + | {{#set: molecular-weight=540.914}} | |
− | |||
− | |||
− | {{#set: common-name= | ||
− | |||
− | {{#set: | ||
− | |||
− | {{#set: | ||
− | |||
− | |||
− |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-7526
- common-name:
- 9,9'-di-cis-ζ-carotene
- smiles:
- cc(=cccc(=cccc(c)=cc=cc(=cc=cc=c(c=cc=c(c)ccc=c(ccc=c(c)c)c)c)c)c)c
- inchi-key:
- biwlelkafxrpde-zurblsrnsa-n
- molecular-weight:
- 540.914