Difference between revisions of "CDP-ETHANOLAMINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10721 RXN-10721] == * direction: ** reversible * common-name: ** 3-hydroxy-l-kynurenine-oxoglut...")
(Created page with "Category:metabolite == Metabolite CDP-ETHANOLAMINE == * common-name: ** cdp-ethanolamine * smiles: ** c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10721 RXN-10721] ==
+
== Metabolite CDP-ETHANOLAMINE ==
−
* direction:
 
−
** reversible
 
 
* common-name:
 
* common-name:
−
** 3-hydroxy-l-kynurenine-oxoglutarate transaminase
+
** cdp-ethanolamine
−
** kynurenine-oxoglutarate transaminase
+
* smiles:
−
** kynurenine--oxoglutarate transaminase
+
** c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+]
−
* ec-number:
+
* inchi-key:
−
** [http://enzyme.expasy.org/EC/2.6.1.7 ec-2.6.1.7]
+
** wvimueuqjfpndk-pebgctimsa-m
−
== Reaction formula ==
+
* molecular-weight:
−
* 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[3-HYDROXY-L-KYNURENINE]][c] '''<=>''' 1 [[CPD-11552]][c] '''+''' 1 [[GLT]][c]
+
** 445.239
−
== Gene(s) associated with this reaction  ==
+
== Reaction(s) known to consume the compound ==
−
* Gene: [[SJ03867]]
+
* [[ETHANOLAMINEPHOSPHOTRANSFERASE-RXN]]
−
** Category: [[annotation]]
+
* [[RXN-17731]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) known to produce the compound ==
−
** Category: [[orthology]]
+
* [[2.7.7.14-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ07646]]
+
{{#set: common-name=cdp-ethanolamine}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=wvimueuqjfpndk-pebgctimsa-m}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: molecular-weight=445.239}}
−
== Pathway(s) ==
 
−
* [[PWY-6309]], L-tryptophan degradation XI (mammalian, via kynurenine): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6309 PWY-6309]
 
−
** '''7''' reactions found over '''11''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R04171 R04171]
 
−
{{#set: direction=reversible}}
 
−
{{#set: common-name=3-hydroxy-l-kynurenine-oxoglutarate transaminase|kynurenine-oxoglutarate transaminase|kynurenine--oxoglutarate transaminase}}
 
−
{{#set: ec-number=ec-2.6.1.7}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CDP-ETHANOLAMINE

  • common-name:
    • cdp-ethanolamine
  • smiles:
    • c(cop(op(occ2(c(c(c(n1(c(n=c(c=c1)n)=o))o2)o)o))([o-])=o)([o-])=o)[n+]
  • inchi-key:
    • wvimueuqjfpndk-pebgctimsa-m
  • molecular-weight:
    • 445.239

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CDP-ETHANOLAMINE&oldid=138964"