Difference between revisions of "L-ORNITHINE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ASPARAGINE--TRNA-LIGASE-RXN ASPARAGINE--TRNA-LIGASE-RXN] == * direction: ** left-to-right * common-...")
(Created page with "Category:metabolite == Metabolite L-ORNITHINE == * common-name: ** l-ornithine * smiles: ** c(=o)([o-])c([n+])ccc[n+] * inchi-key: ** ahlphdhhmvztml-bypyzucnsa-o * molecul...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ASPARAGINE--TRNA-LIGASE-RXN ASPARAGINE--TRNA-LIGASE-RXN] ==
+
== Metabolite L-ORNITHINE ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** asparagine-trna ligase
+
** l-ornithine
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/6.1.1.22 ec-6.1.1.22]
+
** c(=o)([o-])c([n+])ccc[n+]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[ASN]][c] '''+''' 1 [[ASN-tRNAs]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[AMP]][c] '''+''' 1 [[Charged-ASN-tRNAs]][c] '''+''' 1 [[PPI]][c]
+
** ahlphdhhmvztml-bypyzucnsa-o
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ20233]]
+
** 133.17
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ACETYLORNDEACET-RXN]]
−
* Gene: [[SJ18954]]
+
* [[ARGINASE-RXN]]
−
** Category: [[annotation]]
+
* [[ORDC]]
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[ORNCARBAMTRANSFER-RXN]]
−
** Category: [[orthology]]
+
* [[ORNDECARBOX-RXN]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
−
== Pathway(s) ==
+
* [[ORNITHINE-CYCLODEAMINASE-RXN]]
−
* [[TRNA-CHARGING-PWY]], tRNA charging: [http://metacyc.org/META/NEW-IMAGE?object=TRNA-CHARGING-PWY TRNA-CHARGING-PWY]
+
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
−
** '''21''' reactions found over '''21''' reactions in the full pathway
+
* [[RXN-13482]]
−
== Reconstruction information  ==
+
* [[biomass_rxn]]
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
+
== Reaction(s) known to produce the compound ==
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
* [[ACETYLORNDEACET-RXN]]
−
== External links  ==
+
* [[AODAA]]
−
* RHEA:
+
* [[ARGINASE-RXN]]
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=11181 11181]
+
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
−
* LIGAND-RXN:
+
* [[ORNCARBAMTRANSFER-RXN]]
−
** [http://www.genome.jp/dbget-bin/www_bget?R03648 R03648]
+
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
−
* UNIPROT:
+
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
−
** [http://www.uniprot.org/uniprot/P39772 P39772]
+
* [[RXN-13482]]
−
** [http://www.uniprot.org/uniprot/O57980 O57980]
+
== Reaction(s) of unknown directionality ==
−
** [http://www.uniprot.org/uniprot/Q9V251 Q9V251]
+
{{#set: common-name=l-ornithine}}
−
** [http://www.uniprot.org/uniprot/Q9CEK9 Q9CEK9]
+
{{#set: inchi-key=inchikey=ahlphdhhmvztml-bypyzucnsa-o}}
−
** [http://www.uniprot.org/uniprot/P47359 P47359]
+
{{#set: molecular-weight=133.17}}
−
** [http://www.uniprot.org/uniprot/O51128 O51128]
 
−
** [http://www.uniprot.org/uniprot/O83618 O83618]
 
−
** [http://www.uniprot.org/uniprot/O58008 O58008]
 
−
** [http://www.uniprot.org/uniprot/O96198 O96198]
 
−
** [http://www.uniprot.org/uniprot/P54262 P54262]
 
−
** [http://www.uniprot.org/uniprot/P75521 P75521]
 
−
** [http://www.uniprot.org/uniprot/Q48966 Q48966]
 
−
** [http://www.uniprot.org/uniprot/P0A8M0 P0A8M0]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=asparagine-trna ligase}}
 
−
{{#set: ec-number=ec-6.1.1.22}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite L-ORNITHINE

  • common-name:
    • l-ornithine
  • smiles:
    • c(=o)([o-])c([n+])ccc[n+]
  • inchi-key:
    • ahlphdhhmvztml-bypyzucnsa-o
  • molecular-weight:
    • 133.17

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=L-ORNITHINE&oldid=138981"