Difference between revisions of "CPD-15425"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13162 RXN-13162] == * direction: ** left-to-right * common-name: ** squalene synthase ** farnes...")
(Created page with "Category:metabolite == Metabolite CPD-15425 == * common-name: ** 6''-o-carbamoylkanamycin a * smiles: ** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13162 RXN-13162] ==
+
== Metabolite CPD-15425 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** squalene synthase
+
** 6''-o-carbamoylkanamycin a
−
** farnesyl-diphosphate farnesyltransferase
+
* smiles:
−
* ec-number:
+
** c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
−
** [http://enzyme.expasy.org/EC/2.5.1.21 ec-2.5.1.21]
+
* inchi-key:
−
== Reaction formula ==
+
** prwqrpnqdikfbr-noamyhissa-r
−
* 2 [[FARNESYL-PP]][c] '''+''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NAD-P-OR-NOP]][c] '''+''' 2 [[PPI]][c] '''+''' 1 [[SQUALENE]][c]
+
* molecular-weight:
−
== Gene(s) associated with this reaction  ==
+
** 531.559
−
* Gene: [[SJ13532]]
+
== Reaction(s) known to consume the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-13167]]
−
** Category: [[orthology]]
+
* [[RXN-15285]]
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
== Reaction(s) of unknown directionality ==
−
* Gene: [[SJ02885]]
+
{{#set: common-name=6''-o-carbamoylkanamycin a}}
−
** Category: [[annotation]]
+
{{#set: inchi-key=inchikey=prwqrpnqdikfbr-noamyhissa-r}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
{{#set: molecular-weight=531.559}}
−
== Pathway(s) ==
 
−
* [[PWY-5670]], epoxysqualene biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5670 PWY-5670]
 
−
** '''2''' reactions found over '''2''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* LIGAND-RXN:
 
−
** [http://www.genome.jp/dbget-bin/www_bget?R06223 R06223]
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=32302 32302]
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=32296 32296]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=squalene synthase|farnesyl-diphosphate farnesyltransferase}}
 
−
{{#set: ec-number=ec-2.5.1.21}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=annotation|orthology}}
 
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-15425

  • common-name:
    • 6-o-carbamoylkanamycin a
  • smiles:
    • c([n+])c1(c(o)c(o)c(o)c(o1)oc2(c([n+])cc(c(c2o)oc3(oc(coc(=o)n)c(o)c([n+])c(o)3))[n+]))
  • inchi-key:
    • prwqrpnqdikfbr-noamyhissa-r
  • molecular-weight:
    • 531.559

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-15425&oldid=139057"